Learn More
Triethyl 2-phosphonopropionate, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 174360500
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
For C-C Bond Formation (Olefination)Specifications
| Triethyl 2-phosphonopropionate | |
| 3699-66-9 | |
| 143.0°C to 144.0°C (12.0mmHg) | |
| Authentic | |
| Glass bottle | |
| 1.4310 to 1.4330 | |
| MFCD00009159 | |
| 04, I, 573 | |
| triethyl 2-phosphonopropionate, ethyl 2-diethoxyphosphoryl propanoate, ethyl-2-diethylphosphono propanoate, diethyl 1-carbethoxy ethylphosphonate, propanoic acid, 2-diethoxyphosphinyl-, ethyl ester, diethyl ethoxycarbonylethyl-phosphonate, diethyl 1-ethoxycarbonyl ethanephosphonate, 2-diethoxyphosphinyl propanoic acid ethyl ester, diethyl 1-ethoxycarbonyl ethanephosphonate∼2-phosphonopropionic acid triethyl ester, triethyl2-phosphonopropionate | |
| CCOC(=O)C(C)P(=O)(OCC)OCC | |
| 238.22 | |
| 238.22 |
| 98% | |
| 1.1100g/mL | |
| 88°C | |
| 98% | |
| C9H19O5P | |
| (C2H5O)2P(O)CH(CH3)CO2C2H5 | |
| 50g | |
| 1.11 | |
| BVSRWCMAJISCTD-UHFFFAOYSA-N | |
| ethyl 2-diethoxyphosphorylpropanoate | |
| 107155 | |
| 98% |
Chemical Identifiers
| 3699-66-9 | |
| 238.22 | |
| BVSRWCMAJISCTD-UHFFFAOYSA-N | |
| 107155 | |
| CCOC(=O)C(C)P(=O)(OCC)OCC |
| C9H19O5P | |
| MFCD00009159 | |
| triethyl 2-phosphonopropionate, ethyl 2-diethoxyphosphoryl propanoate, ethyl-2-diethylphosphono propanoate, diethyl 1-carbethoxy ethylphosphonate, propanoic acid, 2-diethoxyphosphinyl-, ethyl ester, diethyl ethoxycarbonylethyl-phosphonate, diethyl 1-ethoxycarbonyl ethanephosphonate, 2-diethoxyphosphinyl propanoic acid ethyl ester, diethyl 1-ethoxycarbonyl ethanephosphonate∼2-phosphonopropionic acid triethyl ester, triethyl2-phosphonopropionate | |
| ethyl 2-diethoxyphosphorylpropanoate |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
If skin irritation occurs: Get medical advice/attention.
If eye irritation persists: Get medical advice/attention.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautious
GHS Signal Word: Warning
EINECSNumber : 223-033-4
RUO â Research Use Only