missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Tributyrin, 97%
Tributyrin, 97%, C15H26O6, CAS Number-60-01-5, butyrin, butyryl triglyceride, glycerol tributanoate, glycerol tributyrate, glyceroltributyrin, glyceryl tributyrate, propane-1,2,3-triyl tributyrate, tributin, tributyrin, tri-n-butyrin, 100mL, Liquid, 96% min. (GC), 02, 273, 305.0 deg.C to 310.0 deg.C | CAS: 60-01-5 | C15H26O6 | 302.36 g/mol
Supplier: Thermo Scientific Chemicals 150881000
| Quantity | 100 mL |
|---|---|
| Packaging | Glass bottle |
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| C15H26O6 | |
| MFCD00009392 | |
| tributyrin, glyceryl tributyrate, glycerol tributyrate, tributin, butyrin, butyryl triglyceride, propane-1,2,3-triyl tributyrate, glycerol tributanoate, glyceroltributyrin, tri-n-butyrin | |
| CHEBI:35020 | |
| CCCC(=O)OCC(COC(=O)CCC)OC(=O)CCC |
Specifications
| Tributyrin | |
| 60-01-5 | |
| Clear colorless to light yellow | |
| 305.0°C to 310.0°C | |
| Conforms | |
| Glass bottle | |
| 1.4340 to 1.437 | |
| 100 mL | |
| 02, 273 | |
| 15, 9785 | |
| Solubility in water: insoluble. Other solubilities: soluble in alcohol and ether | |
| CCCC(=O)OCC(COC(=O)CCC)OC(=O)CCC | |
| 302.36 | |
| CHEBI:35020 | |
| 97% |
| 98% | |
| -75.0°C | |
| 1.0335g/mL | |
| 173°C | |
| 96% min. (GC) | |
| C15H26O6 | |
| (CH3CH2CH2CO2CH2)2CH(O2CCH2CH2CH3) | |
| MFCD00009392 | |
| 1.0335 | |
| tributyrin, glyceryl tributyrate, glycerol tributyrate, tributin, butyrin, butyryl triglyceride, propane-1,2,3-triyl tributyrate, glycerol tributanoate, glyceroltributyrin, tri-n-butyrin | |
| UYXTWWCETRIEDR-UHFFFAOYSA-N | |
| 2,3-di(butanoyloxy)propyl butanoate | |
| 6050 | |
| 302.36 | |
| Liquid |
Safety and Handling
EINECSNumber : 200-451-5
RTECSNumber : ET7350000
TSCA : TSCA