missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Triacetin, USP, 97-102%, Spectrum™ Chemical
TR106, 102-76-1, C9H14O6
Supplier: Spectrum Chemical Mfg Cor TR10620LT
| Quantity | 20 L |
|---|---|
| Packaging | Amber Glass Bottle |
Description
Spectrum™ Chemical Triacetin, USP is used as an antifungal agent. All Spectrum Chemical USP products are manufactured, packaged and stored under current Good Manufacturing Practices (cGMP) per 21CFR part 211 in FDA registered and inspected facilities.Chemical Identifiers
| 102-76-1 | |
| 218.21 | |
| 1,3-bis(acetyloxy)propan-2-yl acetate |
| C9H14O6 | |
| URAYPUMNDPQOKB-UHFFFAOYSA-N | |
| CC(=O)OCC(COC(C)=O)OC(C)=O |
Specifications
| Triacetin | |
| 1 | |
| Amber Glass Bottle | |
| 20 L | |
| CC(=O)OCC(COC(C)=O)OC(C)=O | |
| 218.21 | |
| USP |
| 102-76-1 | |
| 258°C | |
| C9H14O6 | |
| URAYPUMNDPQOKB-UHFFFAOYSA-N | |
| 1,3-bis(acetyloxy)propan-2-yl acetate | |
| 97 to 102% | |
| Liquid |