missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Triacetin, 99%
CAS: 102-76-1 | C9H14O6 | 218.21 g/mol
Supplier: Thermo Scientific Chemicals 139220010
| Quantity | 1 L |
|---|---|
| Packaging | Glass bottle |
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 102-76-1 | |
| 218.21 | |
| triacetin, glyceryl triacetate, glycerol triacetate, glycerin triacetate, enzactin, triacetine, triacetylglycerol, fungacetin, glyped, triacetyl glycerine | |
| CHEBI:9661 | |
| CC(=O)OCC(COC(=O)C)OC(=O)C |
| C9H14O6 | |
| URAYPUMNDPQOKB-UHFFFAOYSA-N | |
| 5541 | |
| 2,3-diacetyloxypropyl acetate |
Specifications
| Triacetin | |
| 3.0°C | |
| 1.1550g/mL | |
| 138°C | |
| 98.5% min. (GC) | |
| C9H14O6 | |
| (CH3CO2CH2)2CH(O2CCH3) | |
| 02,147 | |
| 1.155 | |
| Solubility in water: 64.0g/L (20°C). Other solubilities: soluble in most common organic solvents,slightly soluble in carbon disulfide | |
| CC(=O)OCC(COC(=O)C)OC(=O)C | |
| 218.21 | |
| 23 mPa.s (20°C) | |
| 218.21 | |
| Liquid |
| 102-76-1 | |
| Colorless | |
| 258.0°C | |
| Authentic | |
| Glass bottle | |
| 1.4290 to 1.4330 | |
| 1 L | |
| 15,9751 | |
| triacetin, glyceryl triacetate, glycerol triacetate, glycerin triacetate, enzactin, triacetine, triacetylglycerol, fungacetin, glyped, triacetyl glycerine | |
| URAYPUMNDPQOKB-UHFFFAOYSA-N | |
| 2,3-diacetyloxypropyl acetate | |
| 5541 | |
| CHEBI:9661 | |
| 99% |
Safety and Handling
EINECSNumber : 203-051-9