missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thiomichler's Ketone 97.0+%, TCI America™
[Sensitive spectrophotometric reagent for Au, Ag, Hg and Pd, use for the determination of residual chlorine]
Supplier: TCI America A52011G
Specifications
| Thiomichler′s Ketone [Sensitive spectrophotometric reagent for Au, Ag, Hg and Pd, use for the | |
| 204°C | |
| C17H20N2S | |
| 1 g | |
| KFUJUTFTRXYQMG-UHFFFAOYSA-N | |
| bis[4-(dimethylamino)phenyl]methanethione | |
| 71045 | |
| ≥97.0% (T) |
| 1226-46-6 | |
| Purple-Red | |
| MFCD00040477 | |
| 4,4′C-Bis(dimethylamino)thiobenzophenone, N,N,N′C,N′C-Tetramethyl-4,4′C-diaminothiobenzophenone | |
| CN(C)C1=CC=C(C=C1)C(=S)C2=CC=C(C=C2)N(C)C | |
| 284.421 | |
| 284.42 | |
| Crystalline Powder |
Chemical Identifiers
| 1226-46-6 | |
| 284.421 | |
| KFUJUTFTRXYQMG-UHFFFAOYSA-N | |
| 71045 | |
| CN(C)C1=CC=C(C=C1)C(=S)C2=CC=C(C=C2)N(C)C |
| C17H20N2S | |
| MFCD00040477 | |
| 4,4′C-Bis(dimethylamino)thiobenzophenone, N,N,N′C,N′C-Tetramethyl-4,4′C-diaminothiobenzophenone | |
| bis[4-(dimethylamino)phenyl]methanethione |
Safety and Handling
TSCA : Yes