missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thioflavin T
CAS: 2390-54-7 | C17H19ClN2S | 318.86 g/mol
Supplier: Thermo Scientific Chemicals 211761000
| Quantity | 100 g |
|---|---|
| Packaging | Glass bottle |
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 2390-54-7 | |
| 318.86 | |
| JADVWWSKYZXRGX-UHFFFAOYSA-M | |
| 16953 | |
| 2-[4-(dimethylamino)phenyl]-3,6-dimethyl-1,3-benzothiazol-3-ium chloride |
| C17H19ClN2S | |
| MFCD00011944 | |
| Basic Yellow 1, C.I. 49005 | |
| CHEBI:76023 | |
| [Cl-].CN(C)C1=CC=C(C=C1)C1=[N+](C)C2=CC=C(C)C=C2S1 |
Specifications
| Thioflavin T | |
| C17H19ClN2S | |
| 27, 377 | |
| Solubility in water: soluble. Other solubilities: soluble in most organic solvent | |
| [Cl-].CN(C)C1=CC=C(C=C1)C1=[N+](C)C2=CC=C(C)C=C2S1 | |
| 2-[4-(dimethylamino)phenyl]-3,6-dimethyl-1,3-benzothiazol-3-ium chloride | |
| 16953 | |
| 318.85 | |
| Complies | |
| 100 g |
| 2390-54-7 | |
| MFCD00011944 | |
| Basic Yellow 1, C.I. 49005 | |
| JADVWWSKYZXRGX-UHFFFAOYSA-M | |
| Authentic | |
| 318.86 | |
| CHEBI:76023 | |
| Glass bottle | |
| Ochre/Yellow to Yellow | |
| Powder |
Safety and Handling
EINECSNumber : 219-228-9
TSCA : TSCA