missing translation for 'onlineSavingsMsg'
Learn More
Learn More
MilliporeSigma™ Thioflavin T, Calbiochem™,
A cell-permeable benzothiazole dye that exhibits enhanced fluorescence upon binding to amyloid fibrils
Supplier: MilliporeSigma™ 596200500MG
Specifications
Thioflavin T | |
Yellow | |
MFCD00011944 | |
thioflavin t, thioflavine t, basic yellow 1, 2-4-dimethylamino phenyl-3,6-dimethylbenzo d thiazol-3-ium chloride, setoflavine t, acronol yellow t, tannoflavine t, setoflavin t, rhoduline yellow, thioflavin tg | |
JADVWWSKYZXRGX-UHFFFAOYSA-M | |
2-[4-(dimethylamino)phenyl]-3,6-dimethyl-1,3-benzothiazol-3-ium chloride | |
16953 | |
318.9 |
2390-54-7 | |
C17H19ClN2S | |
500 mg | |
Water: Soluble | |
[Cl-].CN(C)C1=CC=C(C=C1)C1=[N+](C)C2=CC=C(C)C=C2S1 | |
318.86 | |
CHEBI:76023 | |
Solid |
Chemical Identifiers
2390-54-7 | |
318.86 | |
JADVWWSKYZXRGX-UHFFFAOYSA-M | |
16953 | |
2-[4-(dimethylamino)phenyl]-3,6-dimethyl-1,3-benzothiazol-3-ium chloride |
C17H19ClN2S | |
MFCD00011944 | |
thioflavin t, thioflavine t, basic yellow 1, 2-4-dimethylamino phenyl-3,6-dimethylbenzo d thiazol-3-ium chloride, setoflavine t, acronol yellow t, tannoflavine t, setoflavin t, rhoduline yellow, thioflavin tg | |
CHEBI:76023 | |
[Cl-].CN(C)C1=CC=C(C=C1)C1=[N+](C)C2=CC=C(C)C=C2S1 |
Safety and Handling
Recommended Storage : 15° to 25°C (59° to 77°F)