missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Tetraphenylethylene 98.0+%, TCI America™
$68.02 - $333.46
Chemical Identifiers
| CAS | 632-51-9 |
|---|---|
| Molecular Formula | C26H20 |
| Molecular Weight (g/mol) | 332.446 |
| MDL Number | MFCD00004764 |
| InChI Key | JLZUZNKTTIRERF-UHFFFAOYSA-N |
| Synonym | tetraphenylethylene, tetraphenylethene, 1,1,2,2-tetraphenylethene, ethylene, tetraphenyl, 1,1,2,2-tetraphenylethylene, benzene, 1,1',1,1'-1,2-ethenediylidene tetrakis, tetraphenylethylen, 1,2,2-triphenylvinyl benzene, 1,2,2-tetraphenylethylene, 1,1',1,1'-1,2-ethenediylidene tetrakisbenzene |
| PubChem CID | 69437 |
| IUPAC Name | 1,2,2-triphenylethenylbenzene |
| SMILES | C1=CC=C(C=C1)C(=C(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4 |
Chemical Identifiers
| 632-51-9 | |
| 332.446 | |
| JLZUZNKTTIRERF-UHFFFAOYSA-N | |
| 69437 | |
| C1=CC=C(C=C1)C(=C(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4 |
| C26H20 | |
| MFCD00004764 | |
| tetraphenylethylene, tetraphenylethene, 1,1,2,2-tetraphenylethene, ethylene, tetraphenyl, 1,1,2,2-tetraphenylethylene, benzene, 1,1',1,1'-1,2-ethenediylidene tetrakis, tetraphenylethylen, 1,2,2-triphenylvinyl benzene, 1,2,2-tetraphenylethylene, 1,1',1,1'-1,2-ethenediylidene tetrakisbenzene | |
| 1,2,2-triphenylethenylbenzene |
Specifications
| 632-51-9 | |
| White-Yellow | |
| MFCD00004764 | |
| tetraphenylethylene, tetraphenylethene, 1,1,2,2-tetraphenylethene, ethylene, tetraphenyl, 1,1,2,2-tetraphenylethylene, benzene, 1,1',1,1'-1,2-ethenediylidene tetrakis, tetraphenylethylen, 1,2,2-triphenylvinyl benzene, 1,2,2-tetraphenylethylene, 1,1',1,1'-1,2-ethenediylidene tetrakisbenzene | |
| C1=CC=C(C=C1)C(=C(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4 | |
| 332.446 | |
| 332.45 | |
| Crystalline Powder |
| 225°C | |
| C26H20 | |
| 1 g | |
| JLZUZNKTTIRERF-UHFFFAOYSA-N | |
| 1,2,2-triphenylethenylbenzene | |
| 69437 | |
| ≥98.0% (GC) | |
| Tetraphenylethylene |
Safety and Handling
TSCA : Yes