Learn More
Tetramethylammonium hydrogen phthalate, 99+%
In electrolyte formulations | CAS: 79723-02-7 | C12H17NO4 | 239.271 g/mol
$116.86 - $363.66
Chemical Identifiers
| CAS | 79723-02-7 |
|---|---|
| Molecular Formula | C12H17NO4 |
| Molecular Weight (g/mol) | 239.271 |
| MDL Number | MFCD00216634 |
| InChI Key | KQTFRASJMFIJPC-UHFFFAOYSA-M |
| Synonym | tetramethylammonium hydrogen phthalate, methanaminium, n,n,n-trimethyl-, 1,2-benzenedicarboxylate 1:1, tetramethylammonium hydrogenphthalate, hydrogen phthalate; tetramethylammonium, tetramethylammonium phthalate monobasic, phthalic acid mono tetramethylammonium salt, hydrogen phthalate; tetramethylammonium ion, tetramethylammonium hydrogen phthalate, |
| PubChem CID | 12892904 |
| IUPAC Name | 2-carboxybenzoate;tetramethylazanium |
| SMILES | C[N+](C)(C)C.C1=CC=C(C(=C1)C(=O)O)C(=O)[O-] |
Description
Tetramethylammonium hydrogen phthalate is used in electrolyte formulations.
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 79723-02-7 | |
| 239.271 | |
| KQTFRASJMFIJPC-UHFFFAOYSA-M | |
| 12892904 | |
| C[N+](C)(C)C.C1=CC=C(C(=C1)C(=O)O)C(=O)[O-] |
| C12H17NO4 | |
| MFCD00216634 | |
| tetramethylammonium hydrogen phthalate, methanaminium, n,n,n-trimethyl-, 1,2-benzenedicarboxylate 1:1, tetramethylammonium hydrogenphthalate, hydrogen phthalate; tetramethylammonium, tetramethylammonium phthalate monobasic, phthalic acid mono tetramethylammonium salt, hydrogen phthalate; tetramethylammonium ion, tetramethylammonium hydrogen phthalate, | |
| 2-carboxybenzoate;tetramethylazanium |
Specifications
| 79723-02-7 | |
| C12H17NO4 | |
| 25 g | |
| tetramethylammonium hydrogen phthalate, methanaminium, n,n,n-trimethyl-, 1,2-benzenedicarboxylate 1:1, tetramethylammonium hydrogenphthalate, hydrogen phthalate; tetramethylammonium, tetramethylammonium phthalate monobasic, phthalic acid mono tetramethylammonium salt, hydrogen phthalate; tetramethylammonium ion, tetramethylammonium hydrogen phthalate, | |
| KQTFRASJMFIJPC-UHFFFAOYSA-M | |
| 2-carboxybenzoate;tetramethylazanium | |
| 12892904 | |
| ≥99% | |
| Tetramethylammonium hydrogen phthalate |
| 148°C to 150°C | |
| MFCD00216634 | |
| UN2811 | |
| Partly soluble in water. | |
| C[N+](C)(C)C.C1=CC=C(C(=C1)C(=O)O)C(=O)[O-] | |
| 239.271 | |
| 239.27 | |
| Crystalline |
Safety and Handling
GHS H Statement
H301-H373
Toxic if swallowed.
May cause damage to organs through prolonged or repeated exposure.
P260-P264b-P270-P301+P310-P314-P330-P501c
H301-H373
DOTInformation : Transport Hazard Class: 6.1; Packing Group: III; Proper Shipping Name: TOXIC SOLIDS, ORGANIC, N.O.S.
EINECSNumber : 416-900-5
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only