missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Tetrabutylammonium Fluoride (ca. 1mol/L in Tetrahydrofuran), TCI America™
[for Catalyst of silylation and cleavage of silyl ether]
Supplier: TCI America T112525ML
Specifications
| Tetrabutylammonium Fluoride (ca. 1mol/L in Tetrahydrofuran) [for Catalyst of acylation, silylation a | |
| Yellow | |
| MFCD00011747 | |
| 2924 | |
| FPGGTKZVZWFYPV-UHFFFAOYSA-M | |
| tetrabutylazanium fluoride | |
| 2724141 | |
| 261.47 |
| 429-41-4 | |
| C16H36FN | |
| 25 mL | |
| tetrabutylammonium fluoride, tbaf, tetrabutylazanium fluoride, tetrabutyl ammonium fluoride, tetra-n-butylammonium fluoride, tetrabutylamine, fluoride, n,n,n-tributylbutan-1-aminium fluoride, 1-butanaminium, n,n,n-tributyl-, fluoride, n,n,n-tributyl-1-butanaminium fluoride, 1-butanaminium, n,n,n-tributyl-, fluoride 1:1 | |
| [F-].CCCC[N+](CCCC)(CCCC)CCCC | |
| 261.47 | |
| CHEBI:51990 | |
| Liquid |
Chemical Identifiers
| 429-41-4 | |
| 261.47 | |
| FPGGTKZVZWFYPV-UHFFFAOYSA-M | |
| 2724141 | |
| tetrabutylazanium fluoride |
| C16H36FN | |
| MFCD00011747 | |
| tetrabutylammonium fluoride, tbaf, tetrabutylazanium fluoride, tetrabutyl ammonium fluoride, tetra-n-butylammonium fluoride, tetrabutylamine, fluoride, n,n,n-tributylbutan-1-aminium fluoride, 1-butanaminium, n,n,n-tributyl-, fluoride, n,n,n-tributyl-1-butanaminium fluoride, 1-butanaminium, n,n,n-tributyl-, fluoride 1:1 | |
| CHEBI:51990 | |
| [F-].CCCC[N+](CCCC)(CCCC)CCCC |
Safety and Handling
EINECSNumber : (2)-0186
TSCA : Yes