missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Tetrabutylammonium fluoride, 75% solution in water
CAS: 429-41-4 | C16H36FN | 261.47 g/mol
$121.42 - $1000.99
Chemical Identifiers
| CAS | 429-41-4 |
|---|---|
| Molecular Formula | C16H36FN |
| Molecular Weight (g/mol) | 261.47 |
| MDL Number | MFCD00011747 |
| InChI Key | FPGGTKZVZWFYPV-UHFFFAOYSA-M |
| Synonym | tetrabutylammonium fluoride, tbaf, tetrabutylazanium fluoride, tetrabutyl ammonium fluoride, tetra-n-butylammonium fluoride, tetrabutylamine, fluoride, n,n,n-tributylbutan-1-aminium fluoride, 1-butanaminium, n,n,n-tributyl-, fluoride, n,n,n-tributyl-1-butanaminium fluoride, 1-butanaminium, n,n,n-tributyl-, fluoride 1:1 |
| PubChem CID | 2724141 |
| ChEBI | CHEBI:51990 |
| SMILES | [F-].CCCC[N+](CCCC)(CCCC)CCCC |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC451800250
|
Thermo Scientific Chemicals
451800250 |
25 g | Glass bottle |
Each for $121.42
|
|
||||
|
AC451801000
|
Thermo Scientific Chemicals
451801000 |
100 g | Glass Bottle |
Each for $260.98
|
|
||||
|
AC451805000
|
Thermo Scientific Chemicals
451805000 |
500 g | Glass bottle |
Each for $1,000.99
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 429-41-4 | |
| 261.47 | |
| FPGGTKZVZWFYPV-UHFFFAOYSA-M | |
| 2724141 | |
| [F-].CCCC[N+](CCCC)(CCCC)CCCC |
| C16H36FN | |
| MFCD00011747 | |
| tetrabutylammonium fluoride, tbaf, tetrabutylazanium fluoride, tetrabutyl ammonium fluoride, tetra-n-butylammonium fluoride, tetrabutylamine, fluoride, n,n,n-tributylbutan-1-aminium fluoride, 1-butanaminium, n,n,n-tributyl-, fluoride, n,n,n-tributyl-1-butanaminium fluoride, 1-butanaminium, n,n,n-tributyl-, fluoride 1:1 | |
| CHEBI:51990 |
Specifications
| 429-41-4 | |
| Glass bottle | |
| [CH3(CH2)3]4NF | |
| 25 g | |
| 15,9332 | |
| FPGGTKZVZWFYPV-UHFFFAOYSA-M | |
| tetrabutylazanium;fluoride | |
| 2724141 | |
| 261.46 | |
| Liquid |
| 0.9530g/mL | |
| C16H36FN | |
| MFCD00011747 | |
| 0.953 | |
| tetrabutylammonium fluoride, tbaf, tetrabutylazanium fluoride, tetrabutyl ammonium fluoride, tetra-n-butylammonium fluoride, tetrabutylamine, fluoride, n,n,n-tributylbutan-1-aminium fluoride, 1-butanaminium, n,n,n-tributyl-, fluoride, n,n,n-tributyl-1-butanaminium fluoride, 1-butanaminium, n,n,n-tributyl-, fluoride 1:1 | |
| [F-].CCCC[N+](CCCC)(CCCC)CCCC | |
| 261.47 | |
| CHEBI:51990 | |
| 75% in aqueous solution | |
| Tetrabutylammonium fluoride |
Safety and Handling
GHS H Statement
Toxic if swallowed.
Causes severe skin burns and eye damage.
GHS Signal Word: Danger
EINECSNumber : 207-057-2
RUO – Research Use Only