Learn More
Tetrabutylammonium fluoride, 75% solution in water
CAS: 429-41-4 | C16H36FN | 261.47 g/mol
Supplier: Thermo Scientific Chemicals 451801000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Tetrabutylammonium Fluoride | |
| 0.9530g/mL | |
| C16H36FN | |
| MFCD00011747 | |
| 0.953 | |
| tetrabutylammonium fluoride, tbaf, tetrabutylazanium fluoride, tetrabutyl ammonium fluoride, tetra-n-butylammonium fluoride, tetrabutylamine, fluoride, n,n,n-tributylbutan-1-aminium fluoride, 1-butanaminium, n,n,n-tributyl-, fluoride, n,n,n-tributyl-1-butanaminium fluoride, 1-butanaminium, n,n,n-tributyl-, fluoride 1:1 | |
| [F-].CCCC[N+](CCCC)(CCCC)CCCC | |
| 261.47 | |
| CHEBI:51990 |
| 429-41-4 | |
| Glass Bottle | |
| [CH3(CH2)3]4NF | |
| 100 g | |
| 15,9332 | |
| FPGGTKZVZWFYPV-UHFFFAOYSA-M | |
| tetrabutylazanium fluoride | |
| 2724141 | |
| 261.46 |
Chemical Identifiers
| 429-41-4 | |
| 261.47 | |
| FPGGTKZVZWFYPV-UHFFFAOYSA-M | |
| 2724141 | |
| [F-].CCCC[N+](CCCC)(CCCC)CCCC |
| C16H36FN | |
| MFCD00011747 | |
| tetrabutylammonium fluoride, tbaf, tetrabutylazanium fluoride, tetrabutyl ammonium fluoride, tetra-n-butylammonium fluoride, tetrabutylamine, fluoride, n,n,n-tributylbutan-1-aminium fluoride, 1-butanaminium, n,n,n-tributyl-, fluoride, n,n,n-tributyl-1-butanaminium fluoride, 1-butanaminium, n,n,n-tributyl-, fluoride 1:1 | |
| CHEBI:51990 |
Safety and Handling
GHS H Statement
Toxic if swallowed.
Causes severe skin burns and eye damage.
GHS Signal Word: Danger
EINECSNumber : 207-057-2
RUO – Research Use Only