Learn More
Tetrabutylammonium borohydride, 98%
CAS: 33725-74-5 | C16H40BN | 257.31 g/mol
Supplier: Thermo Scientific Chemicals 212900100
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Reduction reagentSpecifications
| Tetrabutylammonium borohydride | |
| 33725-74-5 | |
| White | |
| 98% | |
| C16H40BN | |
| MFCD00012035 | |
| 07,352; 10,378; 11,499 | |
| Solubility in water: reacts. Other solubilities: soluble in aprotic solvent | |
| [BH4-].CCCC[N+](CCCC)(CCCC)CCCC | |
| 257.31 | |
| 257.3 | |
| Crystalline Powder and/or Chunks |
| 98% | |
| 126.0°C to 131.0°C | |
| Authentic | |
| Glass bottle | |
| [CH3(CH2)3]4NBH4 | |
| 10 g | |
| tetrabutylammonium borohydride, tetra-n-butylammonium borohydride, n,n,n-tributylbutan-1-aminium tetrahydroborate, boron 1-; tetrabutylazanium, boron 1-; tetrabutylammonium | |
| GMBOFJFPOCGSOI-UHFFFAOYSA-N | |
| boron(1-);tetrabutylazanium | |
| 9881569 | |
| 98% |
Chemical Identifiers
| 33725-74-5 | |
| 257.31 | |
| GMBOFJFPOCGSOI-UHFFFAOYSA-N | |
| 9881569 | |
| [BH4-].CCCC[N+](CCCC)(CCCC)CCCC |
| C16H40BN | |
| MFCD00012035 | |
| tetrabutylammonium borohydride, tetra-n-butylammonium borohydride, n,n,n-tributylbutan-1-aminium tetrahydroborate, boron 1-; tetrabutylazanium, boron 1-; tetrabutylammonium | |
| boron(1-);tetrabutylazanium |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
In contact with water releases flammable gas.
GHS P Statement
Do not breathe dust/fume/gas/mist/vapors/spray.
Immediately call a POISON CENTER or doctor/physician.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water
GHS Signal Word: Danger
EINECSNumber : 251-658-2
TSCA : TSCA
RUO – Research Use Only