Learn More
Tetrabenzyl pyrophosphate, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 436750010
| Quantity | 1g |
|---|
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 990-91-0 | |
| 538.47 | |
| tetrabenzyl pyrophosphate, tetrabenzyl diphosphate, pyrophosphoric acid tetrabenzyl ester, tetrabenzylpyrophosphate, diphosphoric acid, tetrakis phenylmethyl ester, dibenzyl dibenzyloxyphosphoryl oxyphosphonate, benzyl pyrophosphate, acmc-209sbp, tetra benzyl pyrophosphate, tetrabenzyl diphosphate # | |
| dibenzyl bis(phenylmethoxy)phosphoryl phosphate |
| C28H28O7P2 | |
| NSBNXCZCLRBQTA-UHFFFAOYSA-N | |
| 563183 | |
| C1=CC=C(C=C1)COP(=O)(OCC2=CC=CC=C2)OP(=O)(OCC3=CC=CC=C3)OCC4=CC=CC=C4 |
Specifications
| Tetrabenzyl pyrophosphate | |
| 61.52 to 63.39% (C) | |
| 97.5% min. (HPLC) | |
| C28H28O7P2 | |
| tetrabenzyl pyrophosphate, tetrabenzyl diphosphate, pyrophosphoric acid tetrabenzyl ester, tetrabenzylpyrophosphate, diphosphoric acid, tetrakis phenylmethyl ester, dibenzyl dibenzyloxyphosphoryl oxyphosphonate, benzyl pyrophosphate, acmc-209sbp, tetra benzyl pyrophosphate, tetrabenzyl diphosphate # | |
| C1=CC=C(C=C1)COP(=O)(OCC2=CC=CC=C2)OP(=O)(OCC3=CC=CC=C3)OCC4=CC=CC=C4 | |
| 538.47 | |
| 538.47 |
| 990-91-0 | |
| Authentic | |
| Glass Bottle | |
| 1g | |
| NSBNXCZCLRBQTA-UHFFFAOYSA-N | |
| dibenzyl bis(phenylmethoxy)phosphoryl phosphate | |
| 563183 | |
| 98% |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Immediately call a POISON CENTER or doctor/physician.
IF ON SKIN (or hair): Take off im
GHS Signal Word: Danger