missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Sucrose, Ultrapure Bioreagent, J.T. Baker™
High purity reagents tested for use in biotechnology applications, such as electrophoresis, and liquid chromatography
Supplier: Avantor J.T.Baker 409701
Description
- For Density Gradient Centrifugation and Molecular Biology Applications
Specifications
| Sucrose | |
| Poly Bottle | |
| MFCD00006626 | |
| 1L = 1.59kg | |
| CZMRCDWAGMRECN-PWPRYFECNA-N | |
| (2R,3R,4S,5S,6R)-2-{[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy}-6-(hydroxymethyl)oxane-3,4,5-triol | |
| 5988 | |
| 342.3 |
| 57-50-1 | |
| C12H22O11 | |
| 500 g | |
| sucrose, saccharose, cane sugar, sugar, table sugar, white sugar, d-sucrose, saccharum, rohrzucker, amerfand | |
| OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O | |
| 342.30 | |
| CHEBI:17992 | |
| Ultrapure Bioreagent |
Chemical Identifiers
| 57-50-1 | |
| 342.30 | |
| CZMRCDWAGMRECN-PWPRYFECNA-N | |
| 5988 | |
| OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O |
| C12H22O11 | |
| MFCD00006626 | |
| sucrose, saccharose, cane sugar, sugar, table sugar, white sugar, d-sucrose, saccharum, rohrzucker, amerfand | |
| CHEBI:17992 |