missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Sucrose, Crystal, NF, Spectrum™ Chemical
SU103, 57-50-1, C12H22O11
Supplier: Spectrum Chemical Mfg Cor SU103500GM
| Quantity | 500 g |
|---|
Description
Spectrum™ Chemical Sucrose, Crystal, NF is used in medications to impart a more pleasant taste to often unpalatable chemicals and can be found in many medical dosage forms including chewable tablets, syrups, lozenges, or gums. Spectrum Chemical NF products are manufactured, packaged and stored under current Good Manufacturing Practices (cGMP) per 21CFR part 211 in FDA registered and inspected facilities.Chemical Identifiers
| 57-50-1 | |
| 342.30 | |
| CZMRCDWAGMRECN-PWPRYFECNA-N | |
| OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O |
| C12H22O11 | |
| MFCD00006626 | |
| (2R,3R,4S,5S,6R)-2-{[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy}-6-(hydroxymethyl)oxane-3,4,5-triol |
Specifications
| 57-50-1 | |
| 0.001 | |
| C12H22O11 | |
| 500 g | |
| CZMRCDWAGMRECN-PWPRYFECNA-N | |
| (2R,3R,4S,5S,6R)-2-{[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy}-6-(hydroxymethyl)oxane-3,4,5-triol | |
| NF |
| 1 | |
| Poly Bottle | |
| MFCD00006626 | |
| +66.3° to +67.0° | |
| OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O | |
| 342.30 |