missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Squalane, ≥99.0% (GC), Honeywell™ Fluka™
for GC,≥99.0%
Supplier: Honeywell Chemicals 8562950ML
| Quantity | 50 mL |
|---|
Description
- Leading the Industry For Over 65 Years
- Honeywell now delivers Fluka™ premium grade inorganic reagents worldwide – with consistency, purity, and accuracy assured
Chemical Identifiers
| C30H62 | |
| MFCD00008953 | |
| squalane, perhydrosqualene, dodecahydrosqualene, cosbiol, vitabiosol, spinacane, robane, hexamethyltetracosane, tetracosane, 2,6,10,15,19,23-hexamethyl, hexamethyl tetracosane | |
| 2,6,10,15,19,23-hexamethyltetracosane |
Specifications
| Squalane | |
| -38°C | |
| 0.81g/mL at 25°C | |
| 176°C (0.07 hPa) | |
| Odorless | |
| C30H62 | |
| 50 mL | |
| NONH for all modes of transport | |
| squalane, perhydrosqualene, dodecahydrosqualene, cosbiol, vitabiosol, spinacane, robane, hexamethyltetracosane, tetracosane, 2,6,10,15,19,23-hexamethyl, hexamethyl tetracosane | |
| PRAKJMSDJKAYCZ-UHFFFAOYSA-N | |
| 2,6,10,15,19,23-hexamethyltetracosane | |
| 8089 | |
| ≥99.0% (GC) |
| 111-01-3 | |
| Colorless | |
| Neutral | |
| 218°C (424.4°F) | |
| Glass bottle | |
| [(CH3)2CH(CH2)3CH(CH3)(CH2)3CH(CH3)CH2CH2-]2 | |
| MFCD00008953 | |
| 776019 | |
| Insoluble in water | |
| CC(C)CCCC(C)CCCC(C)CCCCC(C)CCCC(C)CCCC(C)C | |
| 422.826 | |
| 422.81g/mol |