Learn More
Sodium triacetoxyborohydride, 97%
CAS: 56553-60-7 | C6H10BNaO6 | 211.94 g/mol
Supplier: Thermo Scientific Chemicals 291825000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Reduction reagentSpecifications
| Sodium triacetoxyborohydride | |
| 114°C to 118°C | |
| Authentic | |
| Glass bottle | |
| NaB(O2CCH3)3H | |
| 500 g | |
| 15, 8822 | |
| Solubility in water: reacts. Other solubilities: soluble in thf,acetonitrile,1,2-dichloroethane | |
| [Na+].CC(=O)O[BH-](OC(C)=O)OC(C)=O | |
| 211.94 | |
| 97% |
| 56553-60-7 | |
| White | |
| 96% min | |
| C6H10BNaO6 | |
| MFCD00012211 | |
| 12,453; 13,283; 06,553; 16,309 | |
| c6h10bnao6, sodium triacetoxyboron 1-, pubchem12871, sodium triacetoxy borohyride, sodium triacetyloxyboron 1-, tris acetoxy hydroborate sodium salt, sodium bis acetyloxy-$l^ 2-boranuidyl acetate | |
| HHYFEYBWNZJVFQ-UHFFFAOYSA-N | |
| sodium bis(acetyloxy)boranuidyl acetate | |
| 211.94 | |
| Powder |
Chemical Identifiers
| 56553-60-7 | |
| 211.94 | |
| HHYFEYBWNZJVFQ-UHFFFAOYSA-N | |
| sodium bis(acetyloxy)boranuidyl acetate |
| C6H10BNaO6 | |
| MFCD00012211 | |
| c6h10bnao6, sodium triacetoxyboron 1-, pubchem12871, sodium triacetoxy borohyride, sodium triacetyloxyboron 1-, tris acetoxy hydroborate sodium salt, sodium bis acetyloxy-$l^ 2-boranuidyl acetate | |
| [Na+].CC(=O)O[BH-](OC(C)=O)OC(C)=O |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye damage.
In contact with water releases flammable gases which may ignite spontaneously.
GHS P Statement
Avoid breathing dust/fume/gas/mist/vapors/spray.
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for
GHS Signal Word: Danger
RUO – Research Use Only