missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Sodium Persulfate (White Crystalline Solid/Certified), Fisher Chemical™
$497.83 - $630.83
Chemical Identifiers
| CAS | 7775-27-1 |
|---|---|
| Molecular Formula | Na2O8S2 |
| Molecular Weight (g/mol) | 238.092 |
| MDL Number | MFCD00003501 |
| InChI Key | CHQMHPLRPQMAMX-UHFFFAOYSA-L |
| Synonym | sodium persulfate, sodium peroxydisulfate, sodium peroxodisulfate, peroxydisulfuric acid, disodium salt, disodium peroxodisulphate, sodium persulphate, unii-j49fyf16je, persulfate de sodium french, sodium peroxydisulphate, disodium sulfonatooxy sulfate |
| PubChem CID | 62655 |
| IUPAC Name | disodium;sulfonatooxy sulfate |
| SMILES | [O-]S(=O)(=O)OOS(=O)(=O)[O-].[Na+].[Na+] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
O6114500
|
Thermo Fisher Scientific
O6114500 |
500 g | Poly Bottle |
Each for $497.83
Case of 6 Each for $2,986.98
|
|
||||
|
O61141
|
Thermo Fisher Scientific
O61141 |
1 kg | Poly Bottle |
Each for $630.83
Case of 6 Each for $3,784.98
|
|
||||
Chemical Identifiers
| 7775-27-1 | |
| 238.092 | |
| CHQMHPLRPQMAMX-UHFFFAOYSA-L | |
| 62655 | |
| [O-]S(=O)(=O)OOS(=O)(=O)[O-].[Na+].[Na+] |
| Na2O8S2 | |
| MFCD00003501 | |
| sodium persulfate, sodium peroxydisulfate, sodium peroxodisulfate, peroxydisulfuric acid, disodium salt, disodium peroxodisulphate, sodium persulphate, unii-j49fyf16je, persulfate de sodium french, sodium peroxydisulphate, disodium sulfonatooxy sulfate | |
| disodium;sulfonatooxy sulfate |
Specifications
| 100°C | |
| White | |
| Powder/Solid | |
| ≥98.0 % | |
| MFCD00003501 | |
| CHQMHPLRPQMAMX-UHFFFAOYSA-L | |
| disodium;sulfonatooxy sulfate | |
| 62655 | |
| ≥98.0% | |
| Pass Test | |
| 2.6g/cm³ |
| 7775-27-1 | |
| 5 to 7 | |
| 500 g | |
| Na2O8S2 | |
| sodium persulfate, sodium peroxydisulfate, sodium peroxodisulfate, peroxydisulfuric acid, disodium salt, disodium peroxodisulphate, sodium persulphate, unii-j49fyf16je, persulfate de sodium french, sodium peroxydisulphate, disodium sulfonatooxy sulfate | |
| [O-]S(=O)(=O)OOS(=O)(=O)[O-].[Na+].[Na+] | |
| 238.092 | |
| 238.09 | |
| Certified | |
| Poly Bottle | |
| Sodium Persulfate |
Safety and Handling
Emergency Overview
Oxidizer: Contact with combustible/organic material may cause fire. Harmful if swallowed. Irritating to eyes, respiratory system and skin. May cause sensitization by inhalation and skin contact.
Signal Word: DANGER!
DOTInformation : DOT Class 5.1, : Oxidizer