missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Sodium Oxalate Solution, 0.05M, Honeywell Fluka™
Volumetric, 0.05Â M (COO)2Na2
Supplier: Honeywell-Fluka 3524020L
Description
Honeywell´s high-quality titration products cover the complete titration workflow and include:
- Solutions for volumetric titration (acids, bases, or salts)
- Buffers available as concentrates or ready-to-use
- Reagents for complexometry:
- Aminopolycarboxylic acids (EDTA/NTA analogs)
- Masking agents
- Indicators for volumetric and complexometric titrations
Specifications
| Sodium oxalate solution | |
| 20 L | |
| NaOOCCOONa | |
| NONH for all modes of transport | |
| sodium oxalate, disodium oxalate, natriumoxalat, ethanedioic acid, disodium salt, oxalic acid, disodium salt, natriumoxalat german, stavelan sodny czech, oxalic acid disodium salt, unii-7u0v68lt9x, ethanedioic acid disodium salt | |
| [Na+].[Na+].[O-]C(=O)C([O-])=O | |
| 134.00 | |
| 134g/mol |
| 62-76-0 | |
| C2Na2O4 | |
| MFCD00012465 | |
| 3631622 | |
| ZNCPFRVNHGOPAG-UHFFFAOYSA-L | |
| disodium;oxalate | |
| 6125 |
Chemical Identifiers
| 62-76-0 | |
| 134.00 | |
| ZNCPFRVNHGOPAG-UHFFFAOYSA-L | |
| 6125 | |
| [Na+].[Na+].[O-]C(=O)C([O-])=O |
| C2Na2O4 | |
| MFCD00012465 | |
| sodium oxalate, disodium oxalate, natriumoxalat, ethanedioic acid, disodium salt, oxalic acid, disodium salt, natriumoxalat german, stavelan sodny czech, oxalic acid disodium salt, unii-7u0v68lt9x, ethanedioic acid disodium salt | |
| disodium;oxalate |