missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Sodium Oxalate, ACS Grade, ≥ 99.5%, LabChem™
Supplier: LabChem LC247101
Specifications
| Sodium Oxalate | |
| White | |
| Powder | |
| C2Na2O4 | |
| MFCD00012465 | |
| Soluble in water | |
| [Na+].[Na+].[O-]C(=O)C([O-])=O | |
| 134.00 | |
| 134 | |
| ACS | |
| Poly Bottle | |
| Carbon monoxide; Carbon dioxide |
| 62-76-0 | |
| 100 | |
| 500 g | |
| Na2C2O4 | |
| sodium oxalate, disodium oxalate, natriumoxalat, ethanedioic acid, disodium salt, oxalic acid, disodium salt, natriumoxalat german, stavelan sodny czech, oxalic acid disodium salt, unii-7u0v68lt9x, ethanedioic acid disodium salt | |
| ZNCPFRVNHGOPAG-UHFFFAOYSA-L | |
| disodium oxalate | |
| 6125 | |
| ≥99.5% | |
| Passes Test | |
| 2.34g/cm3 | |
| 2.34g/cm3 |
Chemical Identifiers
| 62-76-0 | |
| 134.00 | |
| ZNCPFRVNHGOPAG-UHFFFAOYSA-L | |
| 6125 | |
| [Na+].[Na+].[O-]C(=O)C([O-])=O |
| C2Na2O4 | |
| MFCD00012465 | |
| sodium oxalate, disodium oxalate, natriumoxalat, ethanedioic acid, disodium salt, oxalic acid, disodium salt, natriumoxalat german, stavelan sodny czech, oxalic acid disodium salt, unii-7u0v68lt9x, ethanedioic acid disodium salt | |
| disodium oxalate |
Safety and Handling
GHS H Statement
Harmful if swallowed or in contact with skin.
Causes serious eye irritation.
GHS P Statement
Wear protective gloves, eye protection.
Wash exposed skin thoroughly after handling.
Do not eat, drink or smoke when using this product.
If swallowed: Rinse mouth.
Call a poison center/doctor if you feel unwell.
If on skin: Wash with plenty of soap and water.
Take off contaminated clothing and wash it before reuse.
Call a poison center/doctor if you feel unwell.
If in eyes: Rinse cautiously with water for several minutes.
Remove contact lenses, if present and easy to do.
Continue rinsing.
If eye irritation persists: Get medical advice/attention.
Take off contaminated clothing and wash it before reuse.
Dispose of contents/container to comply with local, state and federal regulations.
Warning
EINECSNumber : 200-550-3
Recommended Storage : Room Temperature