missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Sodium Oxalate, ≥99.5%, ACS Reagent, Honeywell Fluka™
ACS Reagent,≥99.5%
$163.93 - $534.63
Chemical Identifiers
| CAS | 62-76-0 |
|---|---|
| Molecular Formula | C2Na2O4 |
| Molecular Weight (g/mol) | 134.00 |
| MDL Number | MFCD00012465 |
| InChI Key | ZNCPFRVNHGOPAG-UHFFFAOYSA-L |
| Synonym | sodium oxalate, disodium oxalate, natriumoxalat, ethanedioic acid, disodium salt, oxalic acid, disodium salt, natriumoxalat german, stavelan sodny czech, oxalic acid disodium salt, unii-7u0v68lt9x, ethanedioic acid disodium salt |
| PubChem CID | 6125 |
| IUPAC Name | disodium;oxalate |
| SMILES | [Na+].[Na+].[O-]C(=O)C([O-])=O |
Description
- Leading the Industry For Over 65 Years
- Honeywell now delivers Fluka™ premium grade inorganic reagents worldwide – with consistency, purity, and accuracy assured
Chemical Identifiers
| 62-76-0 | |
| 134.00 | |
| ZNCPFRVNHGOPAG-UHFFFAOYSA-L | |
| 6125 | |
| [Na+].[Na+].[O-]C(=O)C([O-])=O |
| C2Na2O4 | |
| MFCD00012465 | |
| sodium oxalate, disodium oxalate, natriumoxalat, ethanedioic acid, disodium salt, oxalic acid, disodium salt, natriumoxalat german, stavelan sodny czech, oxalic acid disodium salt, unii-7u0v68lt9x, ethanedioic acid disodium salt | |
| disodium;oxalate |
Specifications
| 62-76-0 | |
| C2Na2O4 | |
| MFCD00012465 | |
| 3631622 | |
| ZNCPFRVNHGOPAG-UHFFFAOYSA-L | |
| disodium;oxalate | |
| 6125 | |
| ≥99.5% | |
| Poly Bottle |
| 100 g | |
| NaOOCCOONa | |
| NONH for all modes of transport | |
| sodium oxalate, disodium oxalate, natriumoxalat, ethanedioic acid, disodium salt, oxalic acid, disodium salt, natriumoxalat german, stavelan sodny czech, oxalic acid disodium salt, unii-7u0v68lt9x, ethanedioic acid disodium salt | |
| [Na+].[Na+].[O-]C(=O)C([O-])=O | |
| 134.00 | |
| 134g/mol | |
| ACS Reagent | |
| Sodium Oxalate |
Safety and Handling
P280
H302 + H312
EINECSNumber : 200-550-3