missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Sodium hexafluoroantimonate(V), 98%
CAS: 16925-25-0 | F6NaSb | 258.74 g/mol
$97.81 - $730.84
Chemical Identifiers
| CAS | 16925-25-0 |
|---|---|
| Molecular Formula | F6NaSb |
| Molecular Weight (g/mol) | 258.74 |
| MDL Number | MFCD00003482 |
| InChI Key | HKLMYZVMEYYVBS-UHFFFAOYSA-H |
| Synonym | sodium hexafluoroantimonate, sodium hexafluoroantimonate v, sodium hexafluorostibanuide, sodium hexafluoro antimonate, antimony sodium fluoride, f6sb.na, nasbf6, acmc-20ajo7, sodium hexafluorostiboranuide, hexafluorostibine, sodium salt |
| PubChem CID | 16689647 |
| IUPAC Name | sodium;hexafluoroantimony(1-) |
| SMILES | F[Sb-](F)(F)(F)(F)F.[Na+] |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAB2060414
|
Thermo Scientific Chemicals
B2060414 |
25 g |
Each for $97.81
|
|
|||||
|
AAB2060422
|
Thermo Scientific Chemicals
B2060422 |
100 g |
Each for $233.01
|
|
|||||
|
AAB2060436
|
Thermo Scientific Chemicals
B2060436 |
500 g |
Each for $730.84
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 16925-25-0 | |
| 258.74 | |
| HKLMYZVMEYYVBS-UHFFFAOYSA-H | |
| 16689647 | |
| F[Sb-](F)(F)(F)(F)F.[Na+] |
| F6NaSb | |
| MFCD00003482 | |
| sodium hexafluoroantimonate, sodium hexafluoroantimonate v, sodium hexafluorostibanuide, sodium hexafluoro antimonate, antimony sodium fluoride, f6sb.na, nasbf6, acmc-20ajo7, sodium hexafluorostiboranuide, hexafluorostibine, sodium salt | |
| sodium;hexafluoroantimony(1-) |
Specifications
| 16925-25-0 | |
| F6NaSb | |
| UN1549 | |
| HKLMYZVMEYYVBS-UHFFFAOYSA-H | |
| sodium;hexafluoroantimony(1-) | |
| 16689647 | |
| 98% | |
| 3.38 |
| 25 g | |
| MFCD00003482 | |
| sodium hexafluoroantimonate, sodium hexafluoroantimonate v, sodium hexafluorostibanuide, sodium hexafluoro antimonate, antimony sodium fluoride, f6sb.na, nasbf6, acmc-20ajo7, sodium hexafluorostiboranuide, hexafluorostibine, sodium salt | |
| F[Sb-](F)(F)(F)(F)F.[Na+] | |
| 258.74 | |
| 258.73 | |
| Odorless | |
| Sodium hexafluoroantimonate(V) |
Safety and Handling
GHS H Statement
H302-H332
Harmful if swallowed.
Harmful if inhaled.
P261-P264b-P270-P271-P301+P312-P304+P340-P312-P330-P501c
H302+H332
DOTInformation : Transport Hazard Class: 6.1; Packing Group: III; Proper Shipping Name: ANTIMONY COMPOUNDS, INORGANIC, SOLID, N.O.S.
EINECSNumber : 240-989-8
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only