Learn More
Sodium bis(trimethylsilyl)amide, 95+%, pure
CAS: 1070-89-9 | C6H18NNaSi2 | 183.38 g/mol
Supplier: Thermo Scientific Chemicals 215960250
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Sodium bis(trimethylsilyl)amide | |
| 171°C to 175°C | |
| .916g/mL | |
| 95+% | |
| C6H18NNaSi2 | |
| MFCD00009835 | |
| 01,1046; 03,261; 04,442; 06,529; 12,441; 16,307 | |
| Solubility in water: reacts | |
| C[Si](C)(C)[N-][Si](C)(C)C.[Na+] | |
| 183.38 | |
| 183.38 | |
| Pure |
| 1070-89-9 | |
| Yellow to Beige | |
| Authentic | |
| Glass bottle | |
| [(CH3)3Si]2NNa | |
| 25 g | |
| sodium bis trimethylsilyl amide, n-sodiohexamethyldisilazane, sodium hexamethyldisilazide, nahmds, sodiobis trimethylsilyl amine, sodium bis trimethylsilyl azanide, n-sodium hexamethyldisilazane, sodium-bis trimethylsilyl amide, hexamethyldisilazane sodium salt | |
| WRIKHQLVHPKCJU-UHFFFAOYSA-N | |
| sodium;bis(trimethylsilyl)azanide | |
| 2724254 | |
| 95+% | |
| Crystalline Powder |
Chemical Identifiers
| 1070-89-9 | |
| 183.38 | |
| WRIKHQLVHPKCJU-UHFFFAOYSA-N | |
| 2724254 | |
| C[Si](C)(C)[N-][Si](C)(C)C.[Na+] |
| C6H18NNaSi2 | |
| MFCD00009835 | |
| sodium bis trimethylsilyl amide, n-sodiohexamethyldisilazane, sodium hexamethyldisilazide, nahmds, sodiobis trimethylsilyl amine, sodium bis trimethylsilyl azanide, n-sodium hexamethyldisilazane, sodium-bis trimethylsilyl amide, hexamethyldisilazane sodium salt | |
| sodium;bis(trimethylsilyl)azanide |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
In contact with water releases flammable gas.
Flammable solid.
Reacts violently with water.
GHS P Statement
Keep away from any possible contact with water,because of violent reaction and possible flash fire.
Wear eye protection/face protection.
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
IF IN EYES: Rinse cautiou
GHS Signal Word: Danger
EINECSNumber : 213-983-8
RUO – Research Use Only