missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Sodium Benzoate 98.0+%, TCI Americaâ„¢
$30.24 - $69.92
Chemical Identifiers
| CAS | 532-32-1 |
|---|---|
| Molecular Formula | C7H5NaO2 |
| Molecular Weight (g/mol) | 144.11 |
| MDL Number | MFCD00012463 |
| InChI Key | WXMKPNITSTVMEF-UHFFFAOYSA-M |
| Synonym | sodium benzoate, benzoic acid, sodium salt, benzoic acid sodium salt, sobenate, antimol, benzoate sodium, benzoate of soda, benzoate, sodium, natrium benzoicum, caswell no. 746Show More |
| PubChem CID | 517055 |
| IUPAC Name | sodium benzoate |
| SMILES | [Na+].[O-]C(=O)C1=CC=CC=C1 |
Chemical Identifiers
| 532-32-1 | |
| 144.11 | |
| WXMKPNITSTVMEF-UHFFFAOYSA-M | |
| 517055 | |
| [Na+].[O-]C(=O)C1=CC=CC=C1 |
| C7H5NaO2 | |
| MFCD00012463 | |
| sodium benzoate, benzoic acid, sodium salt, benzoic acid sodium salt, sobenate, antimol, benzoate sodium, benzoate of soda, benzoate, sodium, natrium benzoicum, caswell no. 746Show More | |
| sodium benzoate |
Specifications
| 450°C | |
| White | |
| MFCD00012463 | |
| WXMKPNITSTVMEF-UHFFFAOYSA-M | |
| sodium benzoate | |
| 517055 | |
| ≥98.0% (HPLC,T) | |
| Crystalline Powder |
| 532-32-1 | |
| C7H5NaO2 | |
| sodium benzoate, benzoic acid, sodium salt, benzoic acid sodium salt, sobenate, antimol, benzoate sodium, benzoate of soda, benzoate, sodium, natrium benzoicum, caswell no. 746 | |
| [Na+].[O-]C(=O)C1=CC=CC=C1 | |
| 144.11 | |
| 144.10 | |
| 25 g | |
| Sodium Benzoate |
Safety and Handling
EINECSNumber : (3)-1272&(3)-1293
RTECSNumber : DH6650000
TSCA : Yes