missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Sodium 1-heptanesulfonate monohydrate, 99.0% (T), MilliporeSigma™ Supelco™
Sodium 1-heptanesulfonate monohydrate can be used as an ion-pairing (IP) reagent, to develop ion-pair reversed phase liquid chromatography method, for the determination of antituberculosis drug ethambutol hydrochloride.
Supplier: Merck Emd Millipore 5183310G
Specifications
| 207300-90-1 | |
| CH3(CH2)5 CH2SO3Na · H2O | |
| 10 g | |
| XWZCREJRXRKIRQ-UHFFFAOYSA-M | |
| sodium heptane-1-sulfonate hydrate | |
| 220.26 | |
| For ion pair chromatography |
| C7H17NaO4S | |
| MFCD00149550 | |
| 1-Heptanesulfonic acid sodium salt monohydrate | |
| O.[Na+].CCCCCCCS([O-])(=O)=O | |
| 220.26 | |
| ≥99.0% (T) |
Chemical Identifiers
| 207300-90-1 | |
| 220.26 | |
| XWZCREJRXRKIRQ-UHFFFAOYSA-M | |
| sodium heptane-1-sulfonate hydrate |
| C7H17NaO4S | |
| MFCD00149550 | |
| 1-Heptanesulfonic acid sodium salt monohydrate | |
| O.[Na+].CCCCCCCS([O-])(=O)=O |