missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Saccharin, sodium salt hydrate, 99+%
CAS: 82385-42-0 | C7H4NNaO3S | 205.16 g/mol
Supplier: Thermo Scientific Chemicals 223370010
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Saccharin, sodium salt hydrate | |
| 82385-42-0 | |
| Authentic | |
| Plastic bottle | |
| MFCD00149605 | |
| 27,17 | |
| saccharin sodium salt hydrate | |
| OAZGZMKGRPRHJX-UHFFFAOYSA-M | |
| 1,1-dioxo-1,2-benzothiazol-3-one;molecular hydrogen;sodium;hydrate | |
| 131673955 | |
| 99+% |
| 99+% | |
| Colorless to White | |
| 25ppm Toluenesulfonamides (GC) max | |
| C7H4NNaO3S | |
| 1 kg | |
| 10,8171 | |
| Solubility in water: soluble. Other solubilities: slightly soluble in alcohol, practically insoluble in diethyl ether and, chloroform | |
| [Na+].[O-]S1(=O)=NC(=O)C2=CC=CC=C12 | |
| 205.16 | |
| 205.16 | |
| Crystalline Powder or Crystals |
Chemical Identifiers
| 82385-42-0 | |
| 205.16 | |
| OAZGZMKGRPRHJX-UHFFFAOYSA-M | |
| 131673955 | |
| [Na+].[O-]S1(=O)=NC(=O)C2=CC=CC=C12 |
| C7H4NNaO3S | |
| MFCD00149605 | |
| saccharin sodium salt hydrate | |
| 1,1-dioxo-1,2-benzothiazol-3-one;molecular hydrogen;sodium;hydrate |
RUO – Research Use Only