missing translation for 'onlineSavingsMsg'
Learn More
Learn More
S-Methylisothiouronium sulfate, 98+%
CAS: 867-44-7 | C4H14N4O4S3 | 278.36 g/mol
$56.85 - $654.93
Chemical Identifiers
| CAS | 867-44-7 |
|---|---|
| Molecular Formula | C4H14N4O4S3 |
| Molecular Weight (g/mol) | 278.36 |
| MDL Number | MFCD00013055 |
| InChI Key | BZZXQZOBAUXLHZ-UHFFFAOYSA-N |
| Synonym | s-methylisothiourea hemisulfate, 2-methyl-2-thiopseudourea hemisulfate, carbamimidothioic acid, methyl ester, sulfate 2:1, s-methylisothiourea sulfate 2:1, s-methylthiouronium sulfate 2:1, bis 2-methylisothiouronium sulphate, methyl carbamimidothioate sulfate 2:1, methylcarbamimidothioate sulfate 2:1, s-methylisothiourea, sulfate, 2-methyl-2-thiopseudourea sulfate 2:1 |
| PubChem CID | 13347 |
| IUPAC Name | methyl carbamimidothioate;sulfuric acid |
| SMILES | CSC(=N)N.CSC(=N)N.OS(=O)(=O)O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAA1104422
|
Thermo Scientific Chemicals
A1104422 |
100 g |
Each for $56.85
|
|
|||||
|
AAA1104430
|
Thermo Scientific Chemicals
A1104430 |
250 g |
Each for $86.33
|
|
|||||
|
AAA1104436
|
Thermo Scientific Chemicals
A1104436 |
500 g |
Each for $159.93
|
|
|||||
|
AAA110440E
|
Thermo Scientific Chemicals
A110440E |
2500 g |
Each for $654.93
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 867-44-7 | |
| 278.36 | |
| BZZXQZOBAUXLHZ-UHFFFAOYSA-N | |
| 13347 | |
| CSC(=N)N.CSC(=N)N.OS(=O)(=O)O |
| C4H14N4O4S3 | |
| MFCD00013055 | |
| s-methylisothiourea hemisulfate, 2-methyl-2-thiopseudourea hemisulfate, carbamimidothioic acid, methyl ester, sulfate 2:1, s-methylisothiourea sulfate 2:1, s-methylthiouronium sulfate 2:1, bis 2-methylisothiouronium sulphate, methyl carbamimidothioate sulfate 2:1, methylcarbamimidothioate sulfate 2:1, s-methylisothiourea, sulfate, 2-methyl-2-thiopseudourea sulfate 2:1 | |
| methyl carbamimidothioate;sulfuric acid |
Specifications
| 867-44-7 | |
| 1.28 | |
| MFCD00013055 | |
| 3917217 | |
| s-methylisothiourea hemisulfate, 2-methyl-2-thiopseudourea hemisulfate, carbamimidothioic acid, methyl ester, sulfate 2:1, s-methylisothiourea sulfate 2:1, s-methylthiouronium sulfate 2:1, bis 2-methylisothiouronium sulphate, methyl carbamimidothioate sulfate 2:1, methylcarbamimidothioate sulfate 2:1, s-methylisothiourea, sulfate, 2-methyl-2-thiopseudourea sulfate 2:1 | |
| CSC(=N)N.CSC(=N)N.OS(=O)(=O)O | |
| 278.36 | |
| 278.38 | |
| S-Methylisothiouronium sulfate |
| ∼235°C (decomposition) | |
| C4H14N4O4S3 | |
| 100 g | |
| Hygroscopic | |
| BZZXQZOBAUXLHZ-UHFFFAOYSA-N | |
| methyl carbamimidothioate;sulfuric acid | |
| 13347 | |
| ≥98% |
Safety and Handling
GHS H Statement
H301
Toxic if swallowed.
P264b-P270-P301+P312-P330-P501c
H302
EINECSNumber : 212-759-7
RTECSNumber : UM9200000
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only