Learn More
Thermo Scientific™ Rifaximin, 98%
Supplier: Thermo Scientific™ 461680050
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| Rifaximin | |
| Authentic | |
| C43H51N3O11 | |
| 5g | |
| NZCRJKRKKOLAOJ-XRCRFVBUSA-N | |
| (7S,9E,11S,12R,13S,14R,15R,16R,17S,18S,19E,21Z)-2,15,17,36-tetrahydroxy-11-methoxy-3,7,12,14,16,18,22,30-octamethyl-6,23-dioxo-8,37-dioxa-24,27,33-triazahexacyclo[23.10.1.1â´,â·.0âµ,³âµ.0²â¶,³â´.0²â·,³²]heptatriaconta-1,3,5(35),9,19,21,25(36),26(34),28,30,32-undecaen-13-yl acetate | |
| 72698618 | |
| 98% |
| 80621-81-4 | |
| 98.5% min. (HPLC) | |
| MFCD00864973 | |
| rifaximin | |
| CO[C@H]1\C=C\O[C@@]2(C)OC3=C(C)C(O)=C4C(O)=C(NC(=O)\C(C)=C/C=C/[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@@H]1C)C1=C(N=C5C=C(C)C=CN15)C4=C3C2=O | |
| 785.89 | |
| 785.88 |
Chemical Identifiers
| 80621-81-4 | |
| 785.89 | |
| NZCRJKRKKOLAOJ-XRCRFVBUSA-N | |
| 72698618 | |
| CO[C@H]1\C=C\O[C@@]2(C)OC3=C(C)C(O)=C4C(O)=C(NC(=O)\C(C)=C/C=C/[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@@H]1C)C1=C(N=C5C=C(C)C=CN15)C4=C3C2=O |
| C43H51N3O11 | |
| MFCD00864973 | |
| rifaximin | |
| (7S,9E,11S,12R,13S,14R,15R,16R,17S,18S,19E,21Z)-2,15,17,36-tetrahydroxy-11-methoxy-3,7,12,14,16,18,22,30-octamethyl-6,23-dioxo-8,37-dioxa-24,27,33-triazahexacyclo[23.10.1.1â´,â·.0âµ,³âµ.0²â¶,³â´.0²â·,³²]heptatriaconta-1,3,5(35),9,19,21,25(36),26(34),28,30,32-undecaen-13-yl acetate |
Safety and Handling
GHS H Statement Suspected of damaging fertility or the unborn child.
GHS P Statement Obtain special instructions before use. Wear protective gloves/protective clothing/eye protection/face protection. IF exposed or concerned: Get medical advice/attention.
GHS Signal Word: Warning
RUO â Research Use Only