missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Riboflavin, USP, 98-102%, Spectrum™ Chemical
RI103, 83-88-5, C17H20N4O6
Supplier: Spectrum Chemical Mfg Cor RI10350KGBL
Description
Spectrum™ Chemical Riboflavin, USP is also referred to as vitamin B2 and used as a dietary supplement. All Spectrum Chemical USP products are manufactured, packaged and stored under current Good Manufacturing Practices (cGMP) per 21CFR part 211 in FDA registered and inspected facilities.Specifications
| 83-88-5 | |
| 0.003 | |
| Fiber Drum | |
| MFCD00005022 | |
| -115° to -135° | |
| CC1=C(C)C=C2N(C[C@H](O)[C@H](O)[C@H](O)CO)C3=NC(=O)NC(=O)C3=NC2=C1 | |
| 376.37 | |
| USP |
| 1 | |
| 0.015 | |
| C17H20N4O6 | |
| 50 kg | |
| AUNGANRZJHBGPY-QTZZOOGMNA-N | |
| 7,8-dimethyl-10-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-2H,3H,4H,10H-benzo[g]pteridine-2,4-dione | |
| 98 to 102% |
Chemical Identifiers
| 83-88-5 | |
| 376.37 | |
| AUNGANRZJHBGPY-QTZZOOGMNA-N | |
| CC1=C(C)C=C2N(C[C@H](O)[C@H](O)[C@H](O)CO)C3=NC(=O)NC(=O)C3=NC2=C1 |
| C17H20N4O6 | |
| MFCD00005022 | |
| 7,8-dimethyl-10-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-2H,3H,4H,10H-benzo[g]pteridine-2,4-dione |