missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Rhodamine B 98.0+%, TCI America™
Supplier: TCI America A51021G
Specifications
| Rhodamine B [Ion association reagent for photometric and fluorimetric analysis] | |
| 81-88-9 | |
| MFCD00011931 | |
| PYWVYCXTNDRMGF-UHFFFAOYSA-N | |
| 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-10λâ´-xanthen-10-ylium chloride | |
| 6694 | |
| 479.02 | |
| 1 g |
| 211°C | |
| C28H31ClN2O3 | |
| Basic Violet 10 | |
| [Cl-].CCN(CC)C1=CC2=[O+]C3=CC(=CC=C3C(C3=CC=CC=C3C(O)=O)=C2C=C1)N(CC)CC | |
| 479.02 | |
| CHEBI:52334 | |
| ≥98.0% (T) | |
| Crystal/Powder |
Chemical Identifiers
| 81-88-9 | |
| 479.02 | |
| PYWVYCXTNDRMGF-UHFFFAOYSA-N | |
| 6694 | |
| 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-10λâ´-xanthen-10-ylium chloride |
| C28H31ClN2O3 | |
| MFCD00011931 | |
| Basic Violet 10 | |
| CHEBI:52334 | |
| [Cl-].CCN(CC)C1=CC2=[O+]C3=CC(=CC=C3C(C3=CC=CC=C3C(O)=O)=C2C=C1)N(CC)CC |
Safety and Handling
EINECSNumber : (5)-1973&(5)-4056
RTECSNumber : BP3675000
TSCA : Yes