missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Pyromellitic Acid 98.0+%, TCI America™
Supplier: TCI America B0039500G
Specifications
| Pyromellitic Acid | |
| 286°C | |
| C10H6O8 | |
| 500 g | |
| CYIDZMCFTVVTJO-UHFFFAOYSA-N | |
| benzene-1,2,4,5-tetracarboxylic acid | |
| 6961 | |
| 254.15 | |
| Crystalline Powder |
| 89-05-4 | |
| White | |
| MFCD00002471 | |
| pyromellitic acid, 1,2,4,5-benzenetetracarboxylic acid, usaf xr-20, 1,2,4,5-tetracarboxybenzene, unii-d9uxg2u6zu, 1,2,4,5-benzene-tetracarboxylic acid, d9uxg2u6zu, pubchem21809, acmc-20ap78, 1,4,5-tetracarboxybenzene | |
| C1=C(C(=CC(=C1C(=O)O)C(=O)O)C(=O)O)C(=O)O | |
| 254.15 | |
| CHEBI:45165 | |
| ≥98.0% (T) |
Chemical Identifiers
| 89-05-4 | |
| 254.15 | |
| CYIDZMCFTVVTJO-UHFFFAOYSA-N | |
| 6961 | |
| benzene-1,2,4,5-tetracarboxylic acid |
| C10H6O8 | |
| MFCD00002471 | |
| pyromellitic acid, 1,2,4,5-benzenetetracarboxylic acid, usaf xr-20, 1,2,4,5-tetracarboxybenzene, unii-d9uxg2u6zu, 1,2,4,5-benzene-tetracarboxylic acid, d9uxg2u6zu, pubchem21809, acmc-20ap78, 1,4,5-tetracarboxybenzene | |
| CHEBI:45165 | |
| C1=C(C(=CC(=C1C(=O)O)C(=O)O)C(=O)O)C(=O)O |
Safety and Handling
EINECSNumber : (3)-2950
RTECSNumber : DB9275000
TSCA : Yes