missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Potassium Persulfate, Honeywell Fluka™
ACS Reagent,≥99.0%
Supplier: Honeywell Chemicals 216224100G
Description
- Leading the Industry For Over 65 Years
- Honeywell now delivers Fluka™ premium grade inorganic reagents worldwide – with consistency, purity, and accuracy assured
Specifications
| Potassium Persulfate | |
| 100 g | |
| K2S2O8 | |
| 1492 | |
| USHAGKDGDHPEEY-UHFFFAOYSA-L | |
| dipotassium;sulfonatooxy sulfate | |
| 24412 | |
| ≥99% | |
| Vapor Density: 9.3 (vs air) |
| 7727-21-1 | |
| K2O8S2 | |
| MFCD00011386 | |
| potassium persulfate, anthion, potassium peroxydisulfate, potassium peroxodisulfate, dipotassium peroxydisulfate, potassium peroxydisulphate, dipotassium persulfate, caswell no. 700, dipotassium peroxodisulphate, unii-6b86k0mczc | |
| [O-]S(=O)(=O)OOS(=O)(=O)[O-].[K+].[K+] | |
| 270.309 | |
| 270.32g/mol | |
| ACS Reagent |
Chemical Identifiers
| 7727-21-1 | |
| 270.309 | |
| USHAGKDGDHPEEY-UHFFFAOYSA-L | |
| 24412 | |
| [O-]S(=O)(=O)OOS(=O)(=O)[O-].[K+].[K+] |
| K2O8S2 | |
| MFCD00011386 | |
| potassium persulfate, anthion, potassium peroxydisulfate, potassium peroxodisulfate, dipotassium peroxydisulfate, potassium peroxydisulphate, dipotassium persulfate, caswell no. 700, dipotassium peroxodisulphate, unii-6b86k0mczc | |
| dipotassium;sulfonatooxy sulfate |
Safety and Handling
P220-P261-P280-P305 + P351 + P338-P342 + P311
H272-H302-H315-H317-H319-H334-H335
EINECSNumber : 231-781-8
RTECSNumber : SE0400000