missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Potassium persulfate, 99+%, for analysis
CAS: 7727-21-1 | K2O8S2 | 270.3 g/mol
$47.07 - $813.32
Chemical Identifiers
| CAS | 7727-21-1 |
|---|---|
| Molecular Formula | K2O8S2 |
| Molecular Weight (g/mol) | 270.3 |
| MDL Number | MFCD00011386 |
| InChI Key | USHAGKDGDHPEEY-UHFFFAOYSA-L |
| Synonym | potassium persulfate, anthion, potassium peroxydisulfate, potassium peroxodisulfate, dipotassium peroxydisulfate, potassium peroxydisulphate, dipotassium persulfate, caswell no. 700, dipotassium peroxodisulphate, unii-6b86k0mczc |
| PubChem CID | 24412 |
| IUPAC Name | dipotassium;sulfonatooxy sulfate |
| SMILES | [O-]S(=O)(=O)OOS(=O)(=O)[O-].[K+].[K+] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC202010250
|
Thermo Scientific Chemicals
202010250 |
25 g | Plastic bottle |
Each for $47.07
|
|
||||
|
AC202012500
|
Thermo Scientific Chemicals
202012500 |
250 g | Plastic bottle |
Each for $83.70
|
|
||||
|
AC202015000
|
Thermo Scientific Chemicals
202015000 |
500 g | Plastic bottle |
Each for $120.24
|
|
||||
|
AC202010010
|
Thermo Scientific Chemicals
202010010 |
1 kg | Plastic bottle |
Each for $187.96
|
|
||||
|
AC202010050
|
Thermo Scientific Chemicals
202010050 |
5 kg | Plastic bottle |
Each for $813.32
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Oxidation reagentChemical Identifiers
| 7727-21-1 | |
| 270.3 | |
| USHAGKDGDHPEEY-UHFFFAOYSA-L | |
| 24412 | |
| [O-]S(=O)(=O)OOS(=O)(=O)[O-].[K+].[K+] |
| K2O8S2 | |
| MFCD00011386 | |
| potassium persulfate, anthion, potassium peroxydisulfate, potassium peroxodisulfate, dipotassium peroxydisulfate, potassium peroxydisulphate, dipotassium persulfate, caswell no. 700, dipotassium peroxodisulphate, unii-6b86k0mczc | |
| dipotassium;sulfonatooxy sulfate |
Specifications
| 100.0°C | |
| White | |
| 25 g | |
| K2O8S2 | |
| MFCD00011386 | |
| potassium persulfate, anthion, potassium peroxydisulfate, potassium peroxodisulfate, dipotassium peroxydisulfate, potassium peroxydisulphate, dipotassium persulfate, caswell no. 700, dipotassium peroxodisulphate, unii-6b86k0mczc | |
| USHAGKDGDHPEEY-UHFFFAOYSA-L | |
| dipotassium;sulfonatooxy sulfate | |
| 24412 | |
| ≥99% | |
| Plastic bottle | |
| Potassium persulfate |
| 7727-21-1 | |
| Crystalline Powder | |
| 99% min. (Iodometry) | |
| K2S2O8 | |
| 15,7777 | |
| Solubility in water: 5g/100mL (20°C). Other solubilities: insoluble in alcohol | |
| [O-]S(=O)(=O)OOS(=O)(=O)[O-].[K+].[K+] | |
| 270.3 | |
| 270.3 | |
| Analytical | |
| 2.47 |
Safety and Handling
GHS H Statement
May intensify fire; oxidizer.
Harmful if swallowed.
Causes skin irritation.
May cause an allergic skin reaction.
Causes serious eye irritation.
May cause allergy or asthma symptoms or breathing difficu
GHS P Statement
Keep/Store away from clothing/ combustible materials.
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Wash with plenty of soap and water.
IF INHALED: If breathing is difficult,r
GHS Signal Word: Danger
EINECSNumber : 231-781-8
RUO – Research Use Only