missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Potassium Hydrogen Phthalate (Primary Standard/Meets ACS Specifications), Fisher Chemical™
Note: This reagent is satisfactory for use as a pH standard. For use as an acidimetric standard, this material should be lightly crushed and dried for 2 hours at 120°C to remove any absorbed moisture
$708.75 - $996.17
Chemical Identifiers
| CAS | 877-24-7 |
|---|---|
| Molecular Formula | C8H5KO4 |
| Molecular Weight (g/mol) | 204.222 |
| MDL Number | MFCD00013070 |
| InChI Key | IWZKICVEHNUQTL-UHFFFAOYSA-M |
| Synonym | potassium hydrogen phthalate, potassium biphthalate, monopotassium phthalate, potassium acid phthalate, hydrogen potassium phthalate, phthalic acid monopotassium salt, 1,2-benzenedicarboxylic acid, monopotassium salt, phthalic acid, monopotassium salt, phthalic acid potassium salt, potassium phthalate monobasic |
| PubChem CID | 23676735 |
| IUPAC Name | potassium;2-carboxybenzoate |
| SMILES | C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
P243-100
|
Fisher Chemical
P243100 |
100 g | Glass Bottle |
Each for $708.75
Case of 6 Each for $4,252.50
|
|
||||
|
P243-500
|
Thermo Fisher Scientific
P243500 |
500 g | Glass Bottle |
Each for $996.17
Case of 6 Each for $5,977.02
|
|
||||
Chemical Identifiers
| 877-24-7 | |
| 204.222 | |
| IWZKICVEHNUQTL-UHFFFAOYSA-M | |
| 23676735 | |
| C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
| C8H5KO4 | |
| MFCD00013070 | |
| potassium hydrogen phthalate, potassium biphthalate, monopotassium phthalate, potassium acid phthalate, hydrogen potassium phthalate, phthalic acid monopotassium salt, 1,2-benzenedicarboxylic acid, monopotassium salt, phthalic acid, monopotassium salt, phthalic acid potassium salt, potassium phthalate monobasic | |
| potassium;2-carboxybenzoate |
Specifications
| 877-24-7 | |
| White | |
| ≥98.5 % | |
| C8H5KO4 | |
| MFCD00013070 | |
| potassium hydrogen phthalate, potassium biphthalate, monopotassium phthalate, potassium acid phthalate, hydrogen potassium phthalate, phthalic acid monopotassium salt, 1,2-benzenedicarboxylic acid, monopotassium salt, phthalic acid, monopotassium salt, phthalic acid potassium salt, potassium phthalate monobasic | |
| IWZKICVEHNUQTL-UHFFFAOYSA-M | |
| potassium;2-carboxybenzoate | |
| 23676735 | |
| 99.95 to 100.05% | |
| Solid |
| 295°C | |
| 3.8 to 4.0 | |
| Glass Bottle | |
| 1-(HO2C)-2-(CO2K)-C6H4 | |
| 100 g | |
| 0.005% max. Insoluble Matter | |
| C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] | |
| 204.222 | |
| 204.23 | |
| Also meets ACS specifications | |
| Potassium Hydrogen Phthalate |
Safety and Handling