missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Potassium hydrogen phthalate, ACS reagent, acidimetric standard
CAS: 877-24-7 | C8H5KO4 | 204.22 g/mol
$74.59 - $771.97
Chemical Identifiers
| CAS | 877-24-7 |
|---|---|
| Molecular Formula | C8H5KO4 |
| Molecular Weight (g/mol) | 204.22 |
| MDL Number | MFCD00013070 |
| InChI Key | IWZKICVEHNUQTL-UHFFFAOYSA-M |
| Synonym | potassium hydrogen phthalate, potassium biphthalate, monopotassium phthalate, potassium acid phthalate, hydrogen potassium phthalate, phthalic acid monopotassium salt, 1,2-benzenedicarboxylic acid, monopotassium salt, phthalic acid, monopotassium salt, phthalic acid potassium salt, potassium phthalate monobasic |
| PubChem CID | 23676735 |
| IUPAC Name | potassium;2-carboxybenzoate |
| SMILES | C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC424061000
|
Thermo Scientific Chemicals
424061000 |
100 g | Plastic bottle |
Each for $74.59
|
|
||||
|
AC424065000
|
Thermo Scientific Chemicals
424065000 |
500 g | Plastic bottle |
Each for $218.91
|
|
||||
|
AC424060025
|
Thermo Scientific Chemicals
424060025 |
2.5 kg | Plastic bottle |
Each for $771.97
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 877-24-7 | |
| 204.22 | |
| IWZKICVEHNUQTL-UHFFFAOYSA-M | |
| 23676735 | |
| C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
| C8H5KO4 | |
| MFCD00013070 | |
| potassium hydrogen phthalate, potassium biphthalate, monopotassium phthalate, potassium acid phthalate, hydrogen potassium phthalate, phthalic acid monopotassium salt, 1,2-benzenedicarboxylic acid, monopotassium salt, phthalic acid, monopotassium salt, phthalic acid potassium salt, potassium phthalate monobasic | |
| potassium;2-carboxybenzoate |
Specifications
| 877-24-7 | |
| White | |
| Authentic | |
| C8H5KO4 | |
| MFCD00013070 | |
| 09, 791 | |
| potassium hydrogen phthalate, potassium biphthalate, monopotassium phthalate, potassium acid phthalate, hydrogen potassium phthalate, phthalic acid monopotassium salt, 1,2-benzenedicarboxylic acid, monopotassium salt, phthalic acid, monopotassium salt, phthalic acid potassium salt, potassium phthalate monobasic | |
| IWZKICVEHNUQTL-UHFFFAOYSA-M | |
| potassium;2-carboxybenzoate | |
| 23676735 | |
| 99.95 to 100.05% (on dried substance) | |
| 0.005% max | |
| Potassium hydrogen phthalate |
| 295.0°C to 300.0°C | |
| 4.00 to 4.02 (0.05M soln. at 25°C ±0.2°C) | |
| Plastic bottle | |
| 2-(HO2C)C6H4CO2K | |
| 100 g | |
| 15, 7733 | |
| Solubility in water: 80g/L (20°C). Other solubilities: 330g/L water (100°C),slightly soluble in alcohol | |
| C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] | |
| 204.22 | |
| 204.22 | |
| ACS Reagent | |
| Crystalline Powder or Crystals |
Safety and Handling
EINECSNumber : 212-889-4
RTECSNumber : CZ4326000
TSCA : TSCA
RUO – Research Use Only