missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Potassium Acid Phthalate, ACS Grade, 99.95 to 100.05%, LabChem™
Supplier: LabChem LC186901
Specifications
| Potassium Acid Phthalate | |
| 100 | |
| White | |
| Poly Bottle | |
| KHC8H4O4 | |
| 1.64g/cm3 | |
| Soluble in water | |
| C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] | |
| 204.222 | |
| 204.23 | |
| ACS |
| 877-24-7 | |
| Carbon monoxide; Carbon dioxide | |
| 1.64g/cm3 | |
| C8H5KO4 | |
| 500 g | |
| potassium hydrogen phthalate, potassium biphthalate, monopotassium phthalate, potassium acid phthalate, hydrogen potassium phthalate, phthalic acid monopotassium salt, 1,2-benzenedicarboxylic acid, monopotassium salt, phthalic acid, monopotassium salt, phthalic acid potassium salt, potassium phthalate monobasic | |
| IWZKICVEHNUQTL-UHFFFAOYSA-M | |
| potassium;2-carboxybenzoate | |
| 23676735 | |
| 99.95 to 100.05% | |
| Crystalline Powder |
Chemical Identifiers
| 877-24-7 | |
| 204.222 | |
| potassium hydrogen phthalate, potassium biphthalate, monopotassium phthalate, potassium acid phthalate, hydrogen potassium phthalate, phthalic acid monopotassium salt, 1,2-benzenedicarboxylic acid, monopotassium salt, phthalic acid, monopotassium salt, phthalic acid potassium salt, potassium phthalate monobasic | |
| potassium;2-carboxybenzoate |
| C8H5KO4 | |
| IWZKICVEHNUQTL-UHFFFAOYSA-M | |
| 23676735 | |
| C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
Safety and Handling
GHS H Statement
Causes eye irritation.
GHS P Statement
Wash exposed skin thoroughly after handling.
If in eyes: Rinse cautiously with water for several minutes.
Remove contact lenses, if present and easy to do.
Continue rinsing.
If eye irritation persists: Get medical advice/attention.
Warning
EINECSNumber : 212-889-4
Recommended Storage : Room Temperature