missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Polystyrene Resin cross-linked with 1% DVB (100-200mesh), TCI America™
Supplier: TCI America P143225G
Specifications
| Polystyrene Resin cross-linked with 1% DVB (100-200mesh) | |
| White | |
| 9003-70-7 | |
| styrene/divinylbenzen, divinylbenzene-styrene, styrene divinylbenzene, styrene-divinylbenzene, styrene/divinylbenzene, styrene-divinyl benzene, benzene, diethenyl-, polymer with ethenylbenzene, brominated, st dvb, divinylbenzene; styrene, 1,2-diethenylbenzene; styrene | |
| CC(C)(C)OC(=O)CCC(NC(=O)OCC1C2=CC=CC=C2C2=CC=CC=C12)C=O | |
| 409.48 | |
| Crystalline Powder |
| 9003-70-7 | |
| C24H27NO5 | |
| 25 g | |
| BCIPGSZQUDLGSY-UHFFFAOYNA-N | |
| tert-butyl 4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-5-oxopentanoate | |
| 174664 |
Chemical Identifiers
| 9003-70-7 | |
| 409.48 | |
| BCIPGSZQUDLGSY-UHFFFAOYNA-N | |
| 174664 | |
| CC(C)(C)OC(=O)CCC(NC(=O)OCC1C2=CC=CC=C2C2=CC=CC=C12)C=O |
| C24H27NO5 | |
| 9003-70-7 | |
| styrene/divinylbenzen, divinylbenzene-styrene, styrene divinylbenzene, styrene-divinylbenzene, styrene/divinylbenzene, styrene-divinyl benzene, benzene, diethenyl-, polymer with ethenylbenzene, brominated, st dvb, divinylbenzene; styrene, 1,2-diethenylbenzene; styrene | |
| tert-butyl 4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-5-oxopentanoate |
Safety and Handling
EINECSNumber : (6)-0155&(6)-0167
TSCA : Yes