missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Polysorbate 85
CAS: 9005-70-3 | (C2H4O)x(C2H4O)z(C2H4O)y(C2H4O)wC42H76O7 | NaN g/mol
Supplier: Thermo Scientific Chemicals 334150010
| Quantity | 1 L |
|---|---|
| Packaging | Glass bottle |
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 9005-70-3 | |
| NaN | |
| ZGEQUSWSYZZNAI-CLFAGFIQNA-N | |
| CCCCCCCC\C=C/CCCCCCCC(=O)OCCOCC(OCCOC(=O)CCCCCCC\C=C/CCCCCCCC)C1OCC(OCCO)C1OCCO |
| (C2H4O)x(C2H4O)z(C2H4O)y(C2H4O)wC42H76O7 | |
| MFCD01779641 | |
| Polyoxyethylene (20) Sorbitan Trioleate, Polysorbate 85 |
Specifications
| Polysorbate 85 | |
| 9005-70-3 | |
| Liquid | |
| 1 L | |
| 38 to 52mg KOH/g | |
| Glass bottle | |
| 83 to 98mg KOH/g | |
| (C2H4O)x(C2H4O)z(C2H4O)y(C2H4O)wC42H76O7 | |
| 3% Max. | |
| Polyoxyethylene (20) Sorbitan Trioleate, Polysorbate 85 | |
| ZGEQUSWSYZZNAI-CLFAGFIQNA-N | |
| NaN |
| Colorless | |
| 2mg KOH/g max. | |
| 1.0200g/mL | |
| >200°C | |
| Authentic | |
| 1.4700 to 1.4720 | |
| 1.02 | |
| 300 mPa.s (25°C) | |
| MFCD01779641 | |
| Solubility in water: soluble. Other solubilities: 100g/L isopropyl alcohol, xylene and mineral oil, insoluble in propylene glycol | |
| CCCCCCCC\C=C/CCCCCCCC(=O)OCCOCC(OCCOC(=O)CCCCCCC\C=C/CCCCCCCC)C1OCC(OCCO)C1OCCO |