Learn More
Piperonyl butoxide, 90%, Tech.
CAS: 51-03-6 | C19H30O5 | 338.44 g/mol
$105.71 - $105.71
Chemical Identifiers
| CAS | 51-03-6 |
|---|---|
| Molecular Formula | C19H30O5 |
| Molecular Weight (g/mol) | 338.44 |
| MDL Number | MFCD00005842 |
| InChI Key | FIPWRIJSWJWJAI-UHFFFAOYSA-N |
| Synonym | piperonyl butoxide, butacide, butocide, ethanol butoxide, pyrenone 606, piperonylbutoxide, 6-propylpiperonyl butyl diethylene glycol ether, butyl carbitol 6-propylpiperonyl ether, 5-2-2-butoxyethoxy ethoxy methyl-6-propylbenzo d 1,3 dioxole, butoxide synergist |
| PubChem CID | 5794 |
| ChEBI | CHEBI:32687 |
| IUPAC Name | 5-[2-(2-butoxyethoxy)ethoxymethyl]-6-propyl-1,3-benzodioxole |
| SMILES | CCCCOCCOCCOCC1=CC2=C(OCO2)C=C1CCC |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC334161000
|
Thermo Scientific Chemicals
334161000 |
100 mL | Glass bottle |
Each for $105.71
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 51-03-6 | |
| 338.44 | |
| FIPWRIJSWJWJAI-UHFFFAOYSA-N | |
| 5794 | |
| 5-[2-(2-butoxyethoxy)ethoxymethyl]-6-propyl-1,3-benzodioxole |
| C19H30O5 | |
| MFCD00005842 | |
| piperonyl butoxide, butacide, butocide, ethanol butoxide, pyrenone 606, piperonylbutoxide, 6-propylpiperonyl butyl diethylene glycol ether, butyl carbitol 6-propylpiperonyl ether, 5-2-2-butoxyethoxy ethoxy methyl-6-propylbenzo d 1,3 dioxole, butoxide synergist | |
| CHEBI:32687 | |
| CCCCOCCOCCOCC1=CC2=C(OCO2)C=C1CCC |
Specifications
| 51-03-6 | |
| 1.0600g/mL | |
| 170°C | |
| 88% min. (GC) | |
| C19H30O5 | |
| MFCD00005842 | |
| 19, IV, 779 | |
| 15, 7589 | |
| Solubility in water: practically insoluble. Other solubilities: miscible with methanol,ethanol,benzene,freons,,and other organic solvents | |
| CCCCOCCOCCOCC1=CC2=C(OCO2)C=C1CCC | |
| 338.44 | |
| 40 mPa.s (25°C) | |
| 338.44 | |
| Technical | |
| Piperonyl butoxide, tech., 90% |
| Yellow | |
| 180°C (1.0 mmHg) | |
| Authentic | |
| Glass bottle | |
| 1.4970 to 1.507 | |
| 100 mL | |
| 1.06 | |
| piperonyl butoxide, butacide, butocide, ethanol butoxide, pyrenone 606, piperonylbutoxide, 6-propylpiperonyl butyl diethylene glycol ether, butyl carbitol 6-propylpiperonyl ether, 5-2-2-butoxyethoxy ethoxy methyl-6-propylbenzo d 1,3 dioxole, butoxide synergist | |
| FIPWRIJSWJWJAI-UHFFFAOYSA-N | |
| 5-[2-(2-butoxyethoxy)ethoxymethyl]-6-propyl-1,3-benzodioxole | |
| 5794 | |
| CHEBI:32687 | |
| 90% | |
| Liquid |
Safety and Handling
GHS H Statement
Very toxic to aquatic life with long lasting effects.
GHS P Statement
Avoid release to the environment.
Collect spillage.
Dispose of contents/container to an approved waste disposal plant.
GHS Signal Word: Warning
EINECSNumber : 200-076-7
RTECSNumber : XS8050000
TSCA : TSCA
RUO – Research Use Only