Learn More
Piperine, 98%
CAS: 94-62-2 | C17H19NO3 | 285.34 g/mol
$82.08 - $291.51
Chemical Identifiers
| CAS | 94-62-2 |
|---|---|
| Molecular Formula | C17H19NO3 |
| Molecular Weight (g/mol) | 285.34 |
| MDL Number | MFCD00005839 |
| InChI Key | MXXWOMGUGJBKIW-YPCIICBESA-N |
| Synonym | piperine, 1-piperoylpiperidine, piperin, bioperine, piperoylpiperidine, e,e-1-piperoylpiperidine, n-e,e-piperoyl piperidine, piperidine, 1-piperoyl-, e,e, unii-u71xl721qk, fema no. 2909 |
| PubChem CID | 638024 |
| ChEBI | CHEBI:28821 |
| IUPAC Name | (2E,4E)-5-(1,3-benzodioxol-5-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one |
| SMILES | O=C(\C=C\C=C\C1=CC=C2OCOC2=C1)N1CCCCC1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC381450050
|
Thermo Scientific Chemicals
381450050 |
5 g | Glass bottle |
Each for $82.08
|
|
||||
|
AC381450250
|
Thermo Scientific Chemicals
381450250 |
25 g | Glass bottle |
Each for $291.51
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 94-62-2 | |
| 285.34 | |
| MXXWOMGUGJBKIW-YPCIICBESA-N | |
| 638024 | |
| (2E,4E)-5-(1,3-benzodioxol-5-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one |
| C17H19NO3 | |
| MFCD00005839 | |
| piperine, 1-piperoylpiperidine, piperin, bioperine, piperoylpiperidine, e,e-1-piperoylpiperidine, n-e,e-piperoyl piperidine, piperidine, 1-piperoyl-, e,e, unii-u71xl721qk, fema no. 2909 | |
| CHEBI:28821 | |
| O=C(\C=C\C=C\C1=CC=C2OCOC2=C1)N1CCCCC1 |
Specifications
| 94-62-2 | |
| Tan to White or Tan-Yellow | |
| 97.5% min. (HPLC) | |
| C17H19NO3 | |
| 5 g | |
| piperine, 1-piperoylpiperidine, piperin, bioperine, piperoylpiperidine, e,e-1-piperoylpiperidine, n-e,e-piperoyl piperidine, piperidine, 1-piperoyl-, e,e, unii-u71xl721qk, fema no. 2909 | |
| MXXWOMGUGJBKIW-YPCIICBESA-N | |
| (2E,4E)-5-(1,3-benzodioxol-5-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one | |
| 638024 | |
| 285.34 | |
| Crystalline Powder |
| 128.0°C to 132.0°C | |
| Authentic | |
| Glass bottle | |
| MFCD00005839 | |
| 15, 7584 | |
| Solubility in water: 40 mg/l (18°C). Other solubilities: 1g/15mL alcohol - 1g/1.7mL chloroform, 1g/36mL ether, soluble in benzene and acetic acid, practically insoluble in petroleum ether | |
| O=C(\C=C\C=C\C1=CC=C2OCOC2=C1)N1CCCCC1 | |
| 285.34 | |
| CHEBI:28821 | |
| 98% | |
| Piperine |
Safety and Handling
GHS H Statement
Harmful if swallowed.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
GHS Signal Word: Warning
EINECSNumber : 202-348-
RUO – Research Use Only