missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Picloram, 95%
Belongs to the puridine class of the auxinic compounds similar to the hormone Indole-3-acetic acid (IAA) | CAS: 1918-02-1 | C6H3Cl3N2O2 | 241.45 g/mol
$280.97 - $1125.70
Chemical Identifiers
| CAS | 1918-02-1 |
|---|---|
| Molecular Formula | C6H3Cl3N2O2 |
| Molecular Weight (g/mol) | 241.45 |
| MDL Number | MFCD00012101 |
| InChI Key | NQQVFXUMIDALNH-UHFFFAOYSA-N |
| Synonym | picloram, 4-amino-3,5,6-trichloropicolinic acid, tordon, borolin, grazon, amdon, 2-pyridinecarboxylic acid, 4-amino-3,5,6-trichloro, k-pin, tordon 10k, tordon 22k |
| PubChem CID | 15965 |
| ChEBI | CHEBI:34922 |
| IUPAC Name | 4-amino-3,5,6-trichloropyridine-2-carboxylic acid |
| SMILES | C1(=C(C(=NC(=C1Cl)Cl)C(=O)O)Cl)N |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAJ6670206
|
Thermo Scientific Chemicals
J6670206 |
5 g |
Each for $280.97
|
|
|||||
|
AAJ6670214
|
Thermo Scientific Chemicals
J6670214 |
25 g |
Each for $1,125.70
|
|
|||||
Description
Belongs to the puridine class of the auxinic compounds similar to the hormone Indole-3-acetic acid (IAA)
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 1918-02-1 | |
| 241.45 | |
| NQQVFXUMIDALNH-UHFFFAOYSA-N | |
| 15965 | |
| 4-amino-3,5,6-trichloropyridine-2-carboxylic acid |
| C6H3Cl3N2O2 | |
| MFCD00012101 | |
| picloram, 4-amino-3,5,6-trichloropicolinic acid, tordon, borolin, grazon, amdon, 2-pyridinecarboxylic acid, 4-amino-3,5,6-trichloro, k-pin, tordon 10k, tordon 22k | |
| CHEBI:34922 | |
| C1(=C(C(=NC(=C1Cl)Cl)C(=O)O)Cl)N |
Specifications
| 1918-02-1 | |
| White | |
| >110°C (230°F) | |
| C6H3Cl3N2O2 | |
| 5 g | |
| 14,7397 | |
| Soluble in acetone | |
| C1(=C(C(=NC(=C1Cl)Cl)C(=O)O)Cl)N | |
| 241.45 | |
| CHEBI:34922 | |
| 95% | |
| Picloram |
| 219°C | |
| 421°C | |
| Chlorine-like | |
| MFCD00012101 | |
| 479075 | |
| picloram, 4-amino-3,5,6-trichloropicolinic acid, tordon, borolin, grazon, amdon, 2-pyridinecarboxylic acid, 4-amino-3,5,6-trichloro, k-pin, tordon 10k, tordon 22k | |
| NQQVFXUMIDALNH-UHFFFAOYSA-N | |
| 4-amino-3,5,6-trichloropyridine-2-carboxylic acid | |
| 15965 | |
| 241.46 | |
| Powder |
Safety and Handling
GHS H Statement
H319
Causes serious eye irritation.
P264b-P280i-P305+P351+P338
H319
EINECSNumber : 217-636-1
RTECSNumber : TJ7525000
TSCA : Yes
storageNote1 : 2° to 8°C
Recommended Storage : Keep cold
RUO – Research Use Only