missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Phthalimide, potassium derivative, 99%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 170860025
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| Phthalimide, potassium derivative | |
| Authentic | |
| Plastic bottle | |
| MFCD00005887 | |
| potassium phthalimide, potassium 1,3-dioxoisoindolin-2-ide, n-potassiophthalimide, phthalimide potassium salt, n-potassium phthalimide, unii-x6kka27dil, phthalimide, potassium salt, potassium phthalamide, 1h-isoindole-1,3 2h-dione, potassium salt, x6kka27dil | |
| FYRHIOVKTDQVFC-UHFFFAOYSA-M | |
| potassium;isoindol-2-ide-1,3-dione | |
| 3356745 | |
| 99% |
| 1074-82-4 | |
| 99% | |
| C8H4KNO2 | |
| 2.5kg | |
| Solubility in water: soluble in water | |
| [K+].O=C1[N-]C(=O)C2=CC=CC=C12 | |
| 185.22 | |
| 185.22 |
Chemical Identifiers
| 1074-82-4 | |
| 185.22 | |
| FYRHIOVKTDQVFC-UHFFFAOYSA-M | |
| 3356745 | |
| [K+].O=C1[N-]C(=O)C2=CC=CC=C12 |
| C8H4KNO2 | |
| MFCD00005887 | |
| potassium phthalimide, potassium 1,3-dioxoisoindolin-2-ide, n-potassiophthalimide, phthalimide potassium salt, n-potassium phthalimide, unii-x6kka27dil, phthalimide, potassium salt, potassium phthalamide, 1h-isoindole-1,3 2h-dione, potassium salt, x6kka27dil | |
| potassium;isoindol-2-ide-1,3-dione |
Safety and Handling
EINECSNumber : 214-046-6
RUO â Research Use Only