missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Phthalamide, 97%
CAS: 88-96-0 | C8H8N2O2 | 164.164 g/mol
$80.49 - $218.90
Chemical Identifiers
| CAS | 88-96-0 |
|---|---|
| Molecular Formula | C8H8N2O2 |
| Molecular Weight (g/mol) | 164.164 |
| MDL Number | MFCD00025478 |
| InChI Key | NAYYNDKKHOIIOD-UHFFFAOYSA-N |
| Synonym | phthalamide, 1,2-benzenedicarboxamide, phthaldiamide, phthalic acid diamide, o-carbamoylbenzamide, o-phthalic acid diamide, o-phthalamide, phthalic diamide, ccris 518, unii-7b96053wrs |
| PubChem CID | 6956 |
| ChEBI | CHEBI:38799 |
| IUPAC Name | benzene-1,2-dicarboxamide |
| SMILES | C1=CC=C(C(=C1)C(=O)N)C(=O)N |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAL0860009
|
Thermo Scientific Chemicals
L0860009 |
10 g |
Each for $80.49
|
|
|||||
|
AAL0860018
|
Thermo Scientific Chemicals
L0860018 |
50 g |
Each for $218.90
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 88-96-0 | |
| 164.164 | |
| NAYYNDKKHOIIOD-UHFFFAOYSA-N | |
| 6956 | |
| benzene-1,2-dicarboxamide |
| C8H8N2O2 | |
| MFCD00025478 | |
| phthalamide, 1,2-benzenedicarboxamide, phthaldiamide, phthalic acid diamide, o-carbamoylbenzamide, o-phthalic acid diamide, o-phthalamide, phthalic diamide, ccris 518, unii-7b96053wrs | |
| CHEBI:38799 | |
| C1=CC=C(C(=C1)C(=O)N)C(=O)N |
Specifications
| 88-96-0 | |
| C8H8N2O2 | |
| 10 g | |
| 14,7369 | |
| NAYYNDKKHOIIOD-UHFFFAOYSA-N | |
| benzene-1,2-dicarboxamide | |
| 6956 | |
| 164.16 | |
| Phthalamide |
| 223°C (decomposition) | |
| MFCD00025478 | |
| 1868220 | |
| phthalamide, 1,2-benzenedicarboxamide, phthaldiamide, phthalic acid diamide, o-carbamoylbenzamide, o-phthalic acid diamide, o-phthalamide, phthalic diamide, ccris 518, unii-7b96053wrs | |
| C1=CC=C(C(=C1)C(=O)N)C(=O)N | |
| 164.164 | |
| CHEBI:38799 | |
| 97% |
Safety and Handling
EINECSNumber : 201-870-6
RTECSNumber : CZ2200000
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only