missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Phenyltrimethylammonium tribromide, 97%
CAS: 4207-56-1 | C9H14Br3N | 375.92 g/mol
$350.95 - $350.95
Chemical Identifiers
| CAS | 4207-56-1 |
|---|---|
| Molecular Formula | C9H14Br3N |
| Molecular Weight (g/mol) | 375.92 |
| MDL Number | MFCD00011789 |
| InChI Key | RHXJPCQWYPXLEH-UHFFFAOYSA-N |
| Synonym | mono n,n,n-trimethylbenzenaminium tribromide |
| PubChem CID | 21525000 |
| IUPAC Name | trimethyl(phenyl)azanium;triiodide |
| SMILES | C[N+](C)(C)C1=CC=CC=C1.I[I-]I |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC160941000
|
Thermo Scientific Chemicals
160941000 |
100 g | Plastic bottle |
Each for $350.95
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
C-X bond formation reagentChemical Identifiers
| 4207-56-1 | |
| 375.92 | |
| RHXJPCQWYPXLEH-UHFFFAOYSA-N | |
| 21525000 | |
| C[N+](C)(C)C1=CC=CC=C1.I[I-]I |
| C9H14Br3N | |
| MFCD00011789 | |
| mono n,n,n-trimethylbenzenaminium tribromide | |
| trimethyl(phenyl)azanium;triiodide |
Specifications
| 4207-56-1 | |
| Orange | |
| 97% | |
| C9H14Br3N | |
| MFCD00011789 | |
| 01,855; 02,328; 04,386 | |
| Solubility in water: insoluble. | |
| C[N+](C)(C)C1=CC=CC=C1.I[I-]I | |
| 375.92 | |
| 375.92 | |
| Crystalline Powder |
| 113.0°C to 117.0°C | |
| Authentic | |
| Plastic bottle | |
| C6H5N(CH3)3Br·Br2 | |
| 100 g | |
| mono n,n,n-trimethylbenzenaminium tribromide | |
| RHXJPCQWYPXLEH-UHFFFAOYSA-N | |
| trimethyl(phenyl)azanium;triiodide | |
| 21525000 | |
| 97% | |
| Phenyltrimethylammonium tribromide, 97% |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF SWALLOWED: Rinse mouth.
Do NOT induce vomiting.
IF ON SKIN (or hair): Take off immediately all contaminated clothing.
Rinse skin with wat
GHS Signal Word: Danger
EINECSNumber : 224-127-8
TSCA : TSCA
RUO – Research Use Only