missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Phenyl beta-D-glucopyranoside hydrate, 98%
CAS: 1266359-89- | C12H16O6 | 256.25 g/mol
Supplier: Thermo Scientific Chemicals 376890050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Phenyl β-D-glucopyranoside hydrate | |
| 172.0°C to 176.0°C | |
| Authentic | |
| Glass bottle | |
| MFCD03410292 | |
| −71.50° (20°C c=1,Water) | |
| phenyl beta-d-glucopyranoside, phenylglucoside, phenyl-beta-d-glucopyranoside, phenol glucoside, phenyl beta-d-glucoside, phenyl-beta-d-glucoside, .beta.-d-glucopyranoside, phenyl, unii-4w3pgi3766, aryl beta-d-glucoside, glucopyranoside, phenyl-, beta-d | |
| OC[C@H]1O[C@@H](OC2=CC=CC=C2)[C@H](O)[C@@H](O)[C@@H]1O | |
| 256.25 | |
| CHEBI:28749 | |
| 98% |
| 1266359-89- | |
| White to Beige | |
| 97.5% min. (HPLC) | |
| C12H16O6 | |
| 5 g | |
| − 71.50 | |
| NEZJDVYDSZTRFS-WLEIBRHLNA-N | |
| (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-phenoxyoxane-3,4,5-triol | |
| 65080 | |
| 256.26 | |
| Crystalline Powder or Crystals |
Chemical Identifiers
| 1266359-89- | |
| 256.25 | |
| NEZJDVYDSZTRFS-WLEIBRHLNA-N | |
| 65080 | |
| (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-phenoxyoxane-3,4,5-triol |
| C12H16O6 | |
| MFCD03410292 | |
| phenyl beta-d-glucopyranoside, phenylglucoside, phenyl-beta-d-glucopyranoside, phenol glucoside, phenyl beta-d-glucoside, phenyl-beta-d-glucoside, .beta.-d-glucopyranoside, phenyl, unii-4w3pgi3766, aryl beta-d-glucoside, glucopyranoside, phenyl-, beta-d | |
| CHEBI:28749 | |
| OC[C@H]1O[C@@H](OC2=CC=CC=C2)[C@H](O)[C@@H](O)[C@@H]1O |
RUO – Research Use Only