Learn More
Phenyl benzoate, 99%
CAS: 93-99-2 | C13H10O2 | 198.22 g/mol
$497.29 - $497.29
Chemical Identifiers
| CAS | 93-99-2 |
|---|---|
| Molecular Formula | C13H10O2 |
| Molecular Weight (g/mol) | 198.22 |
| MDL Number | MFCD00003072 |
| InChI Key | FCJSHPDYVMKCHI-UHFFFAOYSA-N |
| Synonym | benzoic acid phenyl ester, diphenylcarboxylate, benzoic acid, phenyl ester, benzoic acid phenyl, phenylbenzoate, unii-b8a3wvz590, phenol, benzoate, dsstox_cid_28185, dsstox_rid_82744, dsstox_gsid_48210 |
| PubChem CID | 7169 |
| ChEBI | CHEBI:86919 |
| IUPAC Name | phenyl benzoate |
| SMILES | C1=CC=C(C=C1)C(=O)OC2=CC=CC=C2 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC162065000
|
Thermo Scientific Chemicals
162065000 |
500 g | Plastic bottle |
Each for $497.29
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 93-99-2 | |
| 198.22 | |
| FCJSHPDYVMKCHI-UHFFFAOYSA-N | |
| 7169 | |
| phenyl benzoate |
| C13H10O2 | |
| MFCD00003072 | |
| benzoic acid phenyl ester, diphenylcarboxylate, benzoic acid, phenyl ester, benzoic acid phenyl, phenylbenzoate, unii-b8a3wvz590, phenol, benzoate, dsstox_cid_28185, dsstox_rid_82744, dsstox_gsid_48210 | |
| CHEBI:86919 | |
| C1=CC=C(C=C1)C(=O)OC2=CC=CC=C2 |
Specifications
| 93-99-2 | |
| 68.0°C to 70.0°C | |
| 298.0°C to 299.0°C | |
| 98.5% min. (GC) | |
| C13H10O2 | |
| MFCD00003072 | |
| 09, 116 | |
| benzoic acid phenyl ester, diphenylcarboxylate, benzoic acid, phenyl ester, benzoic acid phenyl, phenylbenzoate, unii-b8a3wvz590, phenol, benzoate, dsstox_cid_28185, dsstox_rid_82744, dsstox_gsid_48210 | |
| FCJSHPDYVMKCHI-UHFFFAOYSA-N | |
| phenyl benzoate | |
| 7169 | |
| 198.22 | |
| Fine Crystalline Powder |
| 1mg KOH/g max. | |
| White | |
| Authentic | |
| Plastic bottle | |
| C6H5CO2C6H5 | |
| 500 g | |
| 15, 7388 | |
| Solubility in water: insoluble. Other solubilities: soluble in ethanol,ethyl ether and chloroform | |
| C1=CC=C(C=C1)C(=O)OC2=CC=CC=C2 | |
| 198.22 | |
| CHEBI:86919 | |
| 99% | |
| Phenyl benzoate, 99% |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Causes skin irritation.
Causes serious eye irritation.
GHS P Statement
IF ON SKIN: Wash with plenty of soap and water.
Take off contaminated clothing and wash before reuse.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present and easy to do.
Con
GHS Signal Word: Warning
EINECSNumber : 202-293-2
RTECSNumber : DH6299500
TSCA : TSCA
RUO – Research Use Only