missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Phenolphthalein, ACS Grade, LabChem™
Supplier: LabChem LC181989
Specifications
| Phenolphthalein | |
| 450°C | |
| 100 | |
| C20H14O4 | |
| Soluble in water | |
| KJFMBFZCATUALV-UHFFFAOYSA-N | |
| 3,3-bis(4-hydroxyphenyl)-1,3-dihydro-2-benzofuran-1-one | |
| 4764 | |
| 318.32 | |
| Poly Bottle | |
| Carbon dioxide; Carbon monoxide | |
| White | |
| Powder |
| 262°C | |
| 77-09-8 | |
| C20H14O4 | |
| MFCD00005913 | |
| Passes Test | |
| OC1=CC=C(C=C1)C1(OC(=O)C2=CC=CC=C12)C1=CC=C(O)C=C1 | |
| 318.33 | |
| CHEBI:34914 | |
| ACS | |
| 1277kg/m3 | |
| 1,277kg/m3 | |
| 100 g |
Chemical Identifiers
| 77-09-8 | |
| 318.33 | |
| KJFMBFZCATUALV-UHFFFAOYSA-N | |
| CHEBI:34914 | |
| OC1=CC=C(C=C1)C1(OC(=O)C2=CC=CC=C12)C1=CC=C(O)C=C1 |
| C20H14O4 | |
| MFCD00005913 | |
| 4764 | |
| 3,3-bis(4-hydroxyphenyl)-1,3-dihydro-2-benzofuran-1-one |
Safety and Handling
GHS H Statement
Suspected of causing cancer.
GHS P Statement
Obtain special instructions before use.
Do not handle until all safety precautions have been read and understood.
Wear protective gloves/eye protection/face protection.
If exposed or concerned: Get medical attention.
Store locked up.
Dispose of contents/container in accordance with local, state and federal regulations.
Warning
EINECSNumber : 201-004-7
Recommended Storage : Room Temperature