missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Phenolphthalein, 0.08% in Methanol, for Organic Acids, Certified, LabChem™
$42.64 - $73.57
Chemical Identifiers
| CAS | 77-09-8 |
|---|---|
| Molecular Formula | C20H14O4 |
| Molecular Weight (g/mol) | 318.33 |
| MDL Number | MFCD00005913 |
| InChI Key | KJFMBFZCATUALV-UHFFFAOYSA-N |
| PubChem CID | 4764 |
| ChEBI | CHEBI:34914 |
| IUPAC Name | 3,3-bis(4-hydroxyphenyl)-1,3-dihydro-2-benzofuran-1-one |
| SMILES | OC1=CC=C(C=C1)C1(OC(=O)C2=CC=CC=C12)C1=CC=C(O)C=C1 |
Chemical Identifiers
| 77-09-8 | |
| 318.33 | |
| KJFMBFZCATUALV-UHFFFAOYSA-N | |
| CHEBI:34914 | |
| OC1=CC=C(C=C1)C1(OC(=O)C2=CC=CC=C12)C1=CC=C(O)C=C1 |
| C20H14O4 | |
| MFCD00005913 | |
| 4764 | |
| 3,3-bis(4-hydroxyphenyl)-1,3-dihydro-2-benzofuran-1-one |
Specifications
| -98°C | |
| 77-09-8,67-56-1 | |
| C20H14O4 | |
| MFCD00005913 | |
| Soluble in water | |
| KJFMBFZCATUALV-UHFFFAOYSA-N | |
| 3,3-bis(4-hydroxyphenyl)-1,3-dihydro-2-benzofuran-1-one | |
| 4764 | |
| 318.32 | |
| Poly Bottle | |
| Fume; Carbon monoxide; Carbon dioxide; May release flammable gases | |
| Colorless | |
| 11°C | |
| Phenolphthalein, 0.08% in Methanol, for Organic Acids |
| 65°C | |
| 99.92,0.08 | |
| C20H14O4 | |
| UN1993 | |
| Passes Test | |
| OC1=CC=C(C=C1)C1(OC(=O)C2=CC=CC=C12)C1=CC=C(O)C=C1 | |
| 318.33 | |
| CHEBI:34914 | |
| Certified | |
| 0.792g/mL | |
| 0.792g/mL | |
| 125 mL | |
| Liquid |
Safety and Handling
GHS H Statement
Highly flammable liquid and vapor.
Causes damage to organs (central nervous system, optic nerve) (oral, dermal).
GHS P Statement
Keep away from heat, sparks, open flames, hot surfaces.
No smoking.
Keep container tightly closed.
Ground/bond container and receiving equipment.
Use explosion-proof electrical, ventilating, lighting equipment.
Use only non-sparking tools.
Take precautionary measures against static discharge.
Do not breathe mist, vapors, spray.
Do not eat, drink or smoke when using this product.
Wear protective gloves, protective clothing, eye protection, face protection.
Wash exposed skin thoroughly after handling.
Store locked up in a cool, well-ventilated place.
If on skin (or hair): Remove/Take off immediately all contaminated clothing.
Rinse skin with water/shower.
In case of fire: Use carbon dioxide (CO2), powder, alcohol-resistant foam to extinguish.
Dispose of contents/container to comply with local, state and federal regulations.
Danger
Recommended Storage : Room Temperature