missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Phenol Red Indicator, ACS Reagent, Honeywell Fluka™
Indicator, ACS reagent
Supplier: Honeywell Chemicals 3266125G
Description
- Leading the Industry For Over 65 Years
- Honeywell now delivers Fluka™ premium grade inorganic reagents worldwide – with consistency, purity, and accuracy assured
Specifications
| Phenol Red | |
| C19H14O5S | |
| NONH for all modes of transport | |
| Phenolsulfonphthalein | |
| OC1=CC=C(C=C1)C1(OS(=O)(=O)C2=CC=CC=C12)C1=CC=C(O)C=C1 | |
| 354.38 | |
| CHEBI:31991 | |
| ACS Reagent | |
| 6.8 to 8.2 (yellow to red) | |
| 25 g |
| 143-74-8 | |
| MFCD00003552 | |
| 326470 | |
| BELBBZDIHDAJOR-UHFFFAOYSA-N | |
| 4-[3-(4-hydroxyphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]phenol | |
| 4766 | |
| 354.38g/mol | |
| Glass Bottle | |
| Red | |
| Powder |
Chemical Identifiers
| 143-74-8 | |
| 354.38 | |
| BELBBZDIHDAJOR-UHFFFAOYSA-N | |
| 4766 | |
| 4-[3-(4-hydroxyphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]phenol |
| C19H14O5S | |
| MFCD00003552 | |
| Phenolsulfonphthalein | |
| CHEBI:31991 | |
| OC1=CC=C(C=C1)C1(OS(=O)(=O)C2=CC=CC=C12)C1=CC=C(O)C=C1 |
Safety and Handling
P261-P305 + P351 + P338
H315-H319-H335
EINECSNumber : 205-609-7
RTECSNumber : SJ7490000